| Record Information |
|---|
| Version | 1.0 |
|---|
| Creation Date | 2016-09-30 22:34:05 UTC |
|---|
| Update Date | 2020-06-04 20:30:26 UTC |
|---|
| BMDB ID | BMDB0000639 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Galactaric acid |
|---|
| Description | Galactaric acid, also known as mucic acid or galactarate, belongs to the class of organic compounds known as glucuronic acid derivatives. Glucuronic acid derivatives are compounds containing a glucuronic acid moiety (or a derivative), which consists of a glucose moiety with the C6 carbon oxidized to a carboxylic acid. Galactaric acid exists in all living organisms, ranging from bacteria to humans. Based on a literature review a significant number of articles have been published on Galactaric acid. |
|---|
| Structure | |
|---|
| Synonyms | | Value | Source |
|---|
| Acido galactarico | ChEBI | | Acido mucico | ChEBI | | Galactarsaeure | ChEBI | | Galactosaccharic acid | ChEBI | | Galaktarsaeure | ChEBI | | Mucic acid | ChEBI | | Mucinsaeure | ChEBI | | Saccharolactic acid | ChEBI | | Schleimsaeure | ChEBI | | D-Mucic acid | Kegg | | D-Galactaric acid | Kegg | | Galactarate | Kegg | | Galactosaccharate | Generator | | Mucate | Generator | | Saccharolactate | Generator | | D-Mucate | Generator | | D-Galactarate | Generator | | (2R,3S,4R,5S)-2,3,4,5-Tetrahydroxyhexanedioate | HMDB | | (2R,3S,4R,5S)-2,3,4,5-Tetrahydroxyhexanedioic acid | HMDB | | Hexaric acid | HMDB | | Meso-galactaric acid | HMDB | | Schleimsaure | HMDB | | Strontium galactarate mono-hydrate | HMDB | | Galactaric acid, sodium salt | HMDB |
|
|---|
| Chemical Formula | C6H10O8 |
|---|
| Average Molecular Weight | 210.1388 |
|---|
| Monoisotopic Molecular Weight | 210.037567296 |
|---|
| IUPAC Name | (2R,3S,4R,5S)-2,3,4,5-tetrahydroxyhexanedioic acid |
|---|
| Traditional Name | mucin |
|---|
| CAS Registry Number | 526-99-8 |
|---|
| SMILES | O[C@@H]([C@@H](O)[C@H](O)C(O)=O)[C@@H](O)C(O)=O |
|---|
| InChI Identifier | InChI=1S/C6H10O8/c7-1(3(9)5(11)12)2(8)4(10)6(13)14/h1-4,7-10H,(H,11,12)(H,13,14)/t1-,2+,3+,4- |
|---|
| InChI Key | DSLZVSRJTYRBFB-DUHBMQHGSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | belongs to the class of organic compounds known as glucuronic acid derivatives. Glucuronic acid derivatives are compounds containing a glucuronic acid moiety (or a derivative), which consists of a glucose moiety with the C6 carbon oxidized to a carboxylic acid. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Organic oxygen compounds |
|---|
| Class | Organooxygen compounds |
|---|
| Sub Class | Carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | Glucuronic acid derivatives |
|---|
| Alternative Parents | |
|---|
| Substituents | - Glucuronic acid or derivatives
- Medium-chain hydroxy acid
- Medium-chain fatty acid
- Beta-hydroxy acid
- Hydroxy fatty acid
- Monosaccharide
- Hydroxy acid
- Dicarboxylic acid or derivatives
- Alpha-hydroxy acid
- Fatty acyl
- Fatty acid
- Secondary alcohol
- Polyol
- Carboxylic acid
- Carboxylic acid derivative
- Hydrocarbon derivative
- Organic oxide
- Carbonyl group
- Alcohol
- Aliphatic acyclic compound
|
|---|
| Molecular Framework | Aliphatic acyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Status | Detected but not Quantified |
|---|
| Origin | |
|---|
| Biofunction | Not Available |
|---|
| Application | Not Available |
|---|
| Cellular locations | |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Properties | | Property | Value | Reference |
|---|
| Melting Point | 220 - 225 °C | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | 3.3 mg/mL at 14 °C | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Predicted Properties | |
|---|
| Spectra |
|---|
| Spectra | |
|---|
