| Record Information |
|---|
| Version | 1.0 |
|---|
| Creation Date | 2016-09-30 22:37:19 UTC |
|---|
| Update Date | 2020-05-11 20:53:04 UTC |
|---|
| BMDB ID | BMDB0000833 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | N-Glycolylneuraminic acid |
|---|
| Description | N-Glycolylneuraminic acid, also known as N-glycolyl-b-neuraminate or gcneu, belongs to the class of organic compounds known as neuraminic acids. These are carbohydrate derivatives containing a neuraminic acid moiety. N-Glycolylneuraminic acid is an extremely weak basic (essentially neutral) compound (based on its pKa). |
|---|
| Structure | |
|---|
| Synonyms | | Value | Source |
|---|
| GcNeu | ChEBI | | N-Glycolyl-beta-neuraminic acid | ChEBI | | Neu5GC | ChEBI | | NeuGc | ChEBI | | NGNA | ChEBI | | N-Glycolyl-b-neuraminate | Generator | | N-Glycolyl-b-neuraminic acid | Generator | | N-Glycolyl-beta-neuraminate | Generator | | N-Glycolyl-β-neuraminate | Generator | | N-Glycolyl-β-neuraminic acid | Generator | | N-Glycolylneuraminate | Generator | | 3,5-Dideoxy-5-((hydroxyacetyl)amino)-D-glycero-D-galacto-2-nonulosonate | HMDB | | 3,5-Dideoxy-5-((hydroxyacetyl)amino)-D-glycero-D-galacto-2-nonulosonic acid | HMDB | | N-Glycoloyl-neuraminate | HMDB | | N-Glycoloylneuraminate | HMDB | | N-Glycoloylneuraminic acid | HMDB | | N-Glycolyl-5-neuraminate | HMDB | | N-Glycolyl-5-neuraminic acid | HMDB | | N-Glycolylneuraminic acid, (alpha-D-gal)-isomer | HMDB | | N-Glycoloyl-b-neuraminate | HMDB | | N-Glycoloyl-b-neuraminic acid | HMDB | | N-Glycoloyl-beta-neuraminate | HMDB | | N-Glycoloyl-β-neuraminate | HMDB | | N-Glycoloyl-β-neuraminic acid | HMDB | | N-Glycolylneuraminic acid | ChEBI |
|
|---|
| Chemical Formula | C11H19NO10 |
|---|
| Average Molecular Weight | 325.2693 |
|---|
| Monoisotopic Molecular Weight | 325.100895833 |
|---|
| IUPAC Name | (2S,4S,5R,6R)-2,4-dihydroxy-5-(2-hydroxyacetamido)-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
|---|
| Traditional Name | N-glycolylneuraminic acid |
|---|
| CAS Registry Number | 1113-83-3 |
|---|
| SMILES | OC[C@@H](O)[C@@H](O)[C@@H]1O[C@@](O)(C[C@H](O)[C@H]1NC(=O)CO)C(O)=O |
|---|
| InChI Identifier | InChI=1S/C11H19NO10/c13-2-5(16)8(18)9-7(12-6(17)3-14)4(15)1-11(21,22-9)10(19)20/h4-5,7-9,13-16,18,21H,1-3H2,(H,12,17)(H,19,20)/t4-,5+,7+,8+,9+,11-/m0/s1 |
|---|
| InChI Key | FDJKUWYYUZCUJX-AJKRCSPLSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | belongs to the class of organic compounds known as neuraminic acids. These are carbohydrate derivatives containing a neuraminic acid moiety. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Organic oxygen compounds |
|---|
| Class | Organooxygen compounds |
|---|
| Sub Class | Carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | Neuraminic acids |
|---|
| Alternative Parents | |
|---|
| Substituents | - Neuraminic acid
- C-glucuronide
- C-glycosyl compound
- Glycosyl compound
- Alpha-hydroxy acid
- Hydroxy acid
- Oxane
- Pyran
- Hemiacetal
- Secondary alcohol
- Carboximidic acid
- Carboximidic acid derivative
- Carboxylic acid derivative
- Carboxylic acid
- Oxacycle
- Organoheterocyclic compound
- Monocarboxylic acid or derivatives
- Organic 1,3-dipolar compound
- Propargyl-type 1,3-dipolar organic compound
- Polyol
- Hydrocarbon derivative
- Organic oxide
- Carbonyl group
- Alcohol
- Organonitrogen compound
- Organic nitrogen compound
- Organopnictogen compound
- Primary alcohol
- Aliphatic heteromonocyclic compound
|
|---|
| Molecular Framework | Aliphatic heteromonocyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Status | Detected but not Quantified |
|---|
| Origin | |
|---|
| Biofunction | Not Available |
|---|
| Application | Not Available |
|---|
| Cellular locations | |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Predicted Properties | |
|---|
| Spectra |
|---|
| Spectra | |
|---|