| Record Information |
|---|
| Version | 1.0 |
|---|
| Creation Date | 2016-09-30 22:39:21 UTC |
|---|
| Update Date | 2020-05-21 16:29:07 UTC |
|---|
| BMDB ID | BMDB0000975 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Trehalose |
|---|
| Description | Trehalose, also known as alpha-D-trehalose or (GLC)2, belongs to the class of organic compounds known as o-glycosyl compounds. These are glycoside in which a sugar group is bonded through one carbon to another group via a O-glycosidic bond. Trehalose exists as a solid, possibly soluble (in water), and an extremely weak basic (essentially neutral) compound (based on its pKa) molecule. Trehalose exists in all living species, ranging from bacteria to humans. Trehalose can be converted into Beta-D-glucose and Alpha-D-glucose; which is mediated by the enzyme trehalase. In cattle, trehalose is involved in the metabolic pathway called the trehalose degradation pathway. |
|---|
| Structure | |
|---|
| Synonyms | | Value | Source |
|---|
| (GLC)2 | ChEBI | | alpha,Alpha'-trehalose | ChEBI | | alpha-D-GLCP-(11)-alpha-D-GLCP | ChEBI | | alpha-D-Glucopyranosyl-alpha-D-glucopyranoside | ChEBI | | alpha-D-Trehalose | ChEBI | | alpha-Trehalose | ChEBI | | D-(+)-Trehalose | ChEBI | | Ergot sugar | ChEBI | | Mycose | ChEBI | | a,Alpha'-trehalose | Generator | | Α,alpha'-trehalose | Generator | | a-D-GLCP-(11)-a-D-GLCP | Generator | | Α-D-GLCP-(11)-α-D-GLCP | Generator | | a-D-Glucopyranosyl-a-D-glucopyranoside | Generator | | Α-D-glucopyranosyl-α-D-glucopyranoside | Generator | | a-D-Trehalose | Generator | | Α-D-trehalose | Generator | | a-Trehalose | Generator | | Α-trehalose | Generator | | alpha,alpha-Trehalose | HMDB | | D-Trehalose-anhydrous | HMDB | | delta-Trehalose-anhydrous | HMDB | | D-Trehalose | HMDB | | Natural trehalose | HMDB | | O-D-Glucopyranosyl-(1→1)-D-glucopyranoside | HMDB | | alpha,Alpha'-D-trehalose | HMDB | | alpha-D-Glucopyranosyl alpha-D-glucopyranoside | HMDB | | Α,α'-D-trehalose | HMDB | | Α,α-trehalose | HMDB | | Α,α’-D-trehalose | HMDB | | Α-D-glucopyranosyl α-D-glucopyranoside | HMDB | | Trehalose | HMDB |
|
|---|
| Chemical Formula | C12H22O11 |
|---|
| Average Molecular Weight | 342.2965 |
|---|
| Monoisotopic Molecular Weight | 342.116211546 |
|---|
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-{[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxane-3,4,5-triol |
|---|
| Traditional Name | α,α'-trehalose |
|---|
| CAS Registry Number | 99-20-7 |
|---|
| SMILES | OC[C@H]1O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O |
|---|
| InChI Identifier | InChI=1S/C12H22O11/c13-1-3-5(15)7(17)9(19)11(21-3)23-12-10(20)8(18)6(16)4(2-14)22-12/h3-20H,1-2H2/t3-,4-,5-,6-,7+,8+,9-,10-,11-,12-/m1/s1 |
|---|
| InChI Key | HDTRYLNUVZCQOY-LIZSDCNHSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | belongs to the class of organic compounds known as o-glycosyl compounds. These are glycoside in which a sugar group is bonded through one carbon to another group via a O-glycosidic bond. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Organic oxygen compounds |
|---|
| Class | Organooxygen compounds |
|---|
| Sub Class | Carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | O-glycosyl compounds |
|---|
| Alternative Parents | |
|---|
| Substituents | - O-glycosyl compound
- Disaccharide
- Oxane
- Secondary alcohol
- Oxacycle
- Organoheterocyclic compound
- Polyol
- Acetal
- Hydrocarbon derivative
- Primary alcohol
- Alcohol
- Aliphatic heteromonocyclic compound
|
|---|
| Molecular Framework | Aliphatic heteromonocyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Status | Detected but not Quantified |
|---|
| Origin | |
|---|
| Biofunction | Not Available |
|---|
| Application | Not Available |
|---|
| Cellular locations | Not Available |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Properties | | Property | Value | Reference |
|---|
| Melting Point | 203 °C | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Predicted Properties | |
|---|
| Spectra |
|---|
| Spectra | |
|---|
