| Record Information |
|---|
| Version | 1.0 |
|---|
| Creation Date | 2016-09-30 22:41:35 UTC |
|---|
| Update Date | 2020-05-11 20:38:40 UTC |
|---|
| BMDB ID | BMDB0001138 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | N-Acetylglutamic acid |
|---|
| Description | N-Acetyl-L-glutamic acid, also known as acetylglutamate or ac-glu-OH, belongs to the class of organic compounds known as glutamic acid and derivatives. Glutamic acid and derivatives are compounds containing glutamic acid or a derivative thereof resulting from reaction of glutamic acid at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. N-Acetyl-L-glutamic acid is an extremely weak basic (essentially neutral) compound (based on its pKa). N-Acetyl-L-glutamic acid exists in all living species, ranging from bacteria to humans. |
|---|
| Structure | |
|---|
| Synonyms | | Value | Source |
|---|
| (S)-2-(Acetylamino)pentanedioic acid | ChEBI | | Ac-glu-OH | ChEBI | | Acetyl-L-glutamic acid | ChEBI | | Acetylglutamic acid | ChEBI | | L-N-Acetylglutamic acid | ChEBI | | N-Ac-glu-OH | ChEBI | | N-ACETYL-L-glutamATE | ChEBI | | N-Acetylglutamic acid | ChEBI | | (S)-2-(Acetylamino)pentanedioate | Generator | | Acetyl-L-glutamate | Generator | | Acetylglutamate | Generator | | L-N-Acetylglutamate | Generator | | N-Acetylglutamate | Generator | | N-Acetylglutamic acid semialdehyde | HMDB | | N-Acetylglutamate, potassium salt, (L)-isomer | HMDB | | N-Acetylglutamate, (D)-isomer | HMDB | | N-Acetylglutamate, calcium salt (1:1), (L)-isomer | HMDB | | N-Acetylglutamate, dipotassium salt, (L)-isomer | HMDB | | N-Acetylglutamate, disodium salt, (L)-isomer | HMDB | | N-Acetylglutamate, calcium salt, (L)-isomer | HMDB | | N-Acetylglutamate, magnesium salt, (L)-isomer | HMDB | | Sodium N-acetylglutamate | HMDB | | N-Acetylglutamate, (DL)-isomer | HMDB | | N-Acetylglutamate, monosodium salt, (L)-isomer | HMDB | | N-Acetyl-L-glutaminic acid | HMDB | | alpha-(N-Acetyl)-L-glutamic acid | HMDB | | Α-(N-acetyl)-L-glutamic acid | HMDB | | NAcGlu | HMDB | | N-Acetyl-L-glutamic acid | Generator, KEGG |
|
|---|
| Chemical Formula | C7H11NO5 |
|---|
| Average Molecular Weight | 189.1659 |
|---|
| Monoisotopic Molecular Weight | 189.063722467 |
|---|
| IUPAC Name | (2S)-2-acetamidopentanedioic acid |
|---|
| Traditional Name | N-acetyl-L-glutamate |
|---|
| CAS Registry Number | 1188-37-0 |
|---|
| SMILES | CC(=O)N[C@@H](CCC(O)=O)C(O)=O |
|---|
| InChI Identifier | InChI=1S/C7H11NO5/c1-4(9)8-5(7(12)13)2-3-6(10)11/h5H,2-3H2,1H3,(H,8,9)(H,10,11)(H,12,13)/t5-/m0/s1 |
|---|
| InChI Key | RFMMMVDNIPUKGG-YFKPBYRVSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | belongs to the class of organic compounds known as glutamic acid and derivatives. Glutamic acid and derivatives are compounds containing glutamic acid or a derivative thereof resulting from reaction of glutamic acid at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Organic acids and derivatives |
|---|
| Class | Carboxylic acids and derivatives |
|---|
| Sub Class | Amino acids, peptides, and analogues |
|---|
| Direct Parent | Glutamic acid and derivatives |
|---|
| Alternative Parents | |
|---|
| Substituents | - Glutamic acid or derivatives
- N-acyl-alpha-amino acid
- N-acyl-alpha amino acid or derivatives
- Dicarboxylic acid or derivatives
- Fatty acid
- Carboximidic acid
- Carboximidic acid derivative
- Carboxylic acid
- Organic 1,3-dipolar compound
- Propargyl-type 1,3-dipolar organic compound
- Carbonyl group
- Organonitrogen compound
- Organooxygen compound
- Hydrocarbon derivative
- Organic oxide
- Organopnictogen compound
- Organic oxygen compound
- Organic nitrogen compound
- Aliphatic acyclic compound
|
|---|
| Molecular Framework | Aliphatic acyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Status | Detected but not Quantified |
|---|
| Origin | Not Available |
|---|
| Biofunction | Not Available |
|---|
| Application | Not Available |
|---|
| Cellular locations | |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Properties | | Property | Value | Reference |
|---|
| Melting Point | 199 - 201 °C | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | 52 mg/mL | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Predicted Properties | |
|---|
| Spectra |
|---|
| Spectra | |
|---|