| Record Information |
|---|
| Version | 1.0 |
|---|
| Creation Date | 2016-09-30 22:45:19 UTC |
|---|
| Update Date | 2020-05-11 20:48:39 UTC |
|---|
| BMDB ID | BMDB0001392 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | p-Aminobenzoic acid |
|---|
| Description | 4-Aminobenzoic acid, also known as paba or p-aminobenzoate, belongs to the class of organic compounds known as aminobenzoic acids. These are benzoic acids containing an amine group attached to the benzene moiety. 4-Aminobenzoic acid exists as a solid, possibly soluble (in water), and a moderately basic compound (based on its pKa) molecule. 4-Aminobenzoic acid exists in all living species, ranging from bacteria to humans. |
|---|
| Structure | |
|---|
| Synonyms | | Value | Source |
|---|
| 1-Amino-4-carboxybenzene | ChEBI | | 4-Amino-benzoic acid | ChEBI | | 4-Aminobenzoesaeure | ChEBI | | 4-Carboxyaniline | ChEBI | | 4-Carboxyphenylamine | ChEBI | | ABEE | ChEBI | | gamma-Aminobenzoic acid | ChEBI | | p-Aminobenzoesaeure | ChEBI | | p-Carboxyaniline | ChEBI | | p-Carboxyphenylamine | ChEBI | | PABA | ChEBI | | Para-aminobenzoic acid | ChEBI | | 4-Aminobenzoic acid | Kegg | | p-Aminobenzoate | Kegg | | RVPaba lipstick | Kegg | | 4-Amino-benzoate | Generator | | g-Aminobenzoate | Generator | | g-Aminobenzoic acid | Generator | | gamma-Aminobenzoate | Generator | | Γ-aminobenzoate | Generator | | Γ-aminobenzoic acid | Generator | | Para-aminobenzoate | Generator | | 4-Aminobenzoate | Generator | | acido P-Aminobenzoico | HMDB | | Acidum paraminobenzoicum | HMDB | | Actipol | HMDB | | Amben | HMDB | | Aminobenzoate | HMDB | | Aminobenzoic acid | HMDB, MeSH | | Aniline-4-carboxylate | HMDB | | Aniline-4-carboxylic acid | HMDB | | Anti-chromotrichia factor | HMDB | | Anticanitic vitamin | HMDB | | Anticantic vitamin | HMDB | | Antichromotrichia factor | HMDB | | Bacterial vitamin H1 | HMDB | | Chromotrichia factor | HMDB | | Hachemina | HMDB, MeSH | | Kyselina P-aminobenzoova | HMDB | | P-amino-Benzoate | HMDB | | P-amino-Benzoic acid | HMDB | | PAB | HMDB | | Pabacyd | HMDB | | Pabafilm | HMDB | | Pabagel | HMDB | | Pabamine | HMDB | | Pabanol | HMDB | | Papacidum | HMDB | | Paraminol | HMDB, MeSH | | Paranate | HMDB | | Potaba | HMDB, MeSH | | Romavit | HMDB | | Rvpaba | HMDB | | Sunbrella | HMDB | | Super shade by coppertone | HMDB | | Trichochromogenic factor | HMDB | | Trochromogenic factor | HMDB | | Vitamin BX | HMDB | | Vitamin h' | HMDB | | 4 Aminobenzoic acid | MeSH, HMDB | | 4 Aminobenzoic acid, potassium salt | MeSH, HMDB | | Epitelplast | MeSH, HMDB | | Jumer brand OF aminobenzoic acid | MeSH, HMDB | | Medea brand OF aminobenzoic acid | MeSH, HMDB | | Paraminan | MeSH, HMDB | | 4-Aminobenzoate, potassium | MeSH, HMDB | | Epit vit | MeSH, HMDB | | Llorens brand OF aminobenzoic acid | MeSH, HMDB | | Pabasan | MeSH, HMDB | | Potassium aminobenzoate | MeSH, HMDB | | 4-Aminobenzoic acid, potassium salt | MeSH, HMDB | | Aminobenzoate, potassium | MeSH, HMDB | | Glenwood brand OF potassium aminobezoate | MeSH, HMDB | | Llorens brand OF aminobenzoic acid sodium salt | MeSH, HMDB | | Magnesium para-aminobenzoate | MeSH, HMDB | | Potassium 4 aminobenzoate | MeSH, HMDB | | Potassium 4-aminobenzoate | MeSH, HMDB | | P Aminobenzoic acid | MeSH, HMDB | | Para aminobenzoic acid | MeSH, HMDB | | Para-aminobenzoate, magnesium | MeSH, HMDB | | p-Aminobenzoic acid | ChEBI |
|
|---|
| Chemical Formula | C7H7NO2 |
|---|
| Average Molecular Weight | 137.136 |
|---|
| Monoisotopic Molecular Weight | 137.047678473 |
|---|
| IUPAC Name | 4-aminobenzoic acid |
|---|
| Traditional Name | sunbrella |
|---|
| CAS Registry Number | 150-13-0 |
|---|
| SMILES | NC1=CC=C(C=C1)C(O)=O |
|---|
| InChI Identifier | InChI=1S/C7H7NO2/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,8H2,(H,9,10) |
|---|
| InChI Key | ALYNCZNDIQEVRV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | belongs to the class of organic compounds known as aminobenzoic acids. These are benzoic acids containing an amine group attached to the benzene moiety. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Benzenoids |
|---|
| Class | Benzene and substituted derivatives |
|---|
| Sub Class | Benzoic acids and derivatives |
|---|
| Direct Parent | Aminobenzoic acids |
|---|
| Alternative Parents | |
|---|
| Substituents | - Aminobenzoic acid
- Benzoic acid
- Benzoyl
- Aniline or substituted anilines
- Amino acid or derivatives
- Amino acid
- Carboxylic acid derivative
- Carboxylic acid
- Monocarboxylic acid or derivatives
- Amine
- Organonitrogen compound
- Organooxygen compound
- Primary amine
- Hydrocarbon derivative
- Organic oxide
- Organopnictogen compound
- Organic oxygen compound
- Organic nitrogen compound
- Aromatic homomonocyclic compound
|
|---|
| Molecular Framework | Aromatic homomonocyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Status | Detected but not Quantified |
|---|
| Origin | |
|---|
| Biofunction | Not Available |
|---|
| Application | Not Available |
|---|
| Cellular locations | Not Available |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Properties | | Property | Value | Reference |
|---|
| Melting Point | 188.5 °C | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | 6.11 mg/mL | Not Available | | LogP | 0.83 | HANSCH,C ET AL. (1995) |
|
|---|
| Predicted Properties | |
|---|
| Spectra |
|---|
| Spectra | |
|---|