| Record Information |
|---|
| Version | 1.0 |
|---|
| Creation Date | 2016-09-30 22:46:23 UTC |
|---|
| Update Date | 2020-04-22 15:08:19 UTC |
|---|
| BMDB ID | BMDB0001470 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Tiglic acid |
|---|
| Description | Tiglic acid, also known as tiglate or tiglinsaeure, belongs to the class of organic compounds known as methyl-branched fatty acids. These are fatty acids with an acyl chain that has a methyl branch. Usually, they are saturated and contain only one or more methyl group. However, branches other than methyl may be present. Based on a literature review a significant number of articles have been published on Tiglic acid. |
|---|
| Structure | |
|---|
| Synonyms | | Value | Source |
|---|
| (e)-2,3-Dimethylacrylic acid | ChEBI | | (e)-2-Methylbut-2-enoic acid | ChEBI | | (e)-2-Methylcrotonic acid | ChEBI | | Methyl methacrylic acid | ChEBI | | Tiglinsaeure | ChEBI | | trans-2,3-Dimethylacrylic acid | ChEBI | | trans-2-Methyl-2-butenoic acid | ChEBI | | trans-2-Methylcrotonic acid | ChEBI | | trans-alpha,beta-Dimethylacrylic acid | ChEBI | | (e)-2,3-Dimethylacrylate | Generator | | (e)-2-Methylbut-2-enoate | Generator | | (e)-2-Methylcrotonate | Generator | | Methyl methacrylate | Generator | | trans-2,3-Dimethylacrylate | Generator | | trans-2-Methyl-2-butenoate | Generator | | trans-2-Methylcrotonate | Generator | | trans-a,b-Dimethylacrylate | Generator | | trans-a,b-Dimethylacrylic acid | Generator | | trans-alpha,beta-Dimethylacrylate | Generator | | trans-Α,β-dimethylacrylate | Generator | | trans-Α,β-dimethylacrylic acid | Generator | | Tiglate | Generator | | (2E)-2-Methyl-2-butenoate | HMDB | | (2E)-2-Methyl-2-butenoic acid | HMDB | | (e)-2-Methyl-2-butenoate | HMDB | | (e)-2-Methyl-2-butenoic acid | HMDB | | (e)-2-Methyl-crotonate | HMDB | | (e)-2-Methyl-crotonic acid | HMDB | | 2,3-Dimethylacrylate | HMDB | | 2,3-Dimethylacrylic acid | HMDB | | 2-Methyl-(e)-2-butenoate | HMDB | | 2-Methyl-(e)-2-butenoic acid | HMDB | | 2-Methyl-2-butenoate | HMDB | | 2-Methyl-2-butenoic acid | HMDB | | 2-Methyl-crotonate | HMDB | | 2-Methyl-crotonic acid | HMDB | | 2-Methylbut-2-enoate | HMDB | | 2-Methylbut-2-enoic acid | HMDB | | Cevadate | HMDB | | Cevadic acid | HMDB | | e-Tiglate | HMDB | | e-Tiglic acid | HMDB | | epsilon-Tiglate | HMDB | | epsilon-Tiglic acid | HMDB | | Methylbutenoicacid | HMDB | | Tiglinate | HMDB | | Tiglinic acid | HMDB | | trans-2-Methylcrotonic acid = trans-2-methyl-2-butenoate | HMDB | | trans-2-Methylcrotonic acid = trans-2-methyl-2-butenoic acid | HMDB | | trans-2-Methylcrotonic acid = trans-2-methyl-2-butenoic acid = tiglinate | HMDB | | trans-2-Methylcrotonic acid = trans-2-methyl-2-butenoic acid = tiglinic acid | HMDB | | Tiglic acid, (Z)-isomer | HMDB | | Tiglic acid, (e)-isomer | HMDB |
|
|---|
| Chemical Formula | C5H8O2 |
|---|
| Average Molecular Weight | 100.1158 |
|---|
| Monoisotopic Molecular Weight | 100.0524295 |
|---|
| IUPAC Name | (2E)-2-methylbut-2-enoic acid |
|---|
| Traditional Name | tiglic acid |
|---|
| CAS Registry Number | 80-59-1 |
|---|
| SMILES | C\C=C(/C)C(O)=O |
|---|
| InChI Identifier | InChI=1S/C5H8O2/c1-3-4(2)5(6)7/h3H,1-2H3,(H,6,7)/b4-3+ |
|---|
| InChI Key | UIERETOOQGIECD-ONEGZZNKSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | belongs to the class of organic compounds known as methyl-branched fatty acids. These are fatty acids with an acyl chain that has a methyl branch. Usually, they are saturated and contain only one or more methyl group. However, branches other than methyl may be present. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Lipids and lipid-like molecules |
|---|
| Class | Fatty Acyls |
|---|
| Sub Class | Fatty acids and conjugates |
|---|
| Direct Parent | Methyl-branched fatty acids |
|---|
| Alternative Parents | |
|---|
| Substituents | - Methyl-branched fatty acid
- Unsaturated fatty acid
- Monocarboxylic acid or derivatives
- Carboxylic acid
- Carboxylic acid derivative
- Organic oxygen compound
- Organic oxide
- Hydrocarbon derivative
- Organooxygen compound
- Carbonyl group
- Aliphatic acyclic compound
|
|---|
| Molecular Framework | Aliphatic acyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Status | Expected but not Quantified |
|---|
| Origin | |
|---|
| Biofunction | Not Available |
|---|
| Application | Not Available |
|---|
| Cellular locations | - Adiposome
- Cell membrane
- Cytoplasm
- Membrane
|
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Properties | | Property | Value | Reference |
|---|
| Melting Point | 61 - 65 °C | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | 1 mg/mL | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Predicted Properties | |
|---|
| Spectra |
|---|
| Spectra | |
|---|