| Record Information |
|---|
| Version | 1.0 |
|---|
| Creation Date | 2016-09-30 22:47:41 UTC |
|---|
| Update Date | 2020-05-11 20:56:45 UTC |
|---|
| BMDB ID | BMDB0001562 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | N5-Formyl-H4F |
|---|
| Description | N5-Formyl-THF, also known as n5-formyl-thf or n5-formyl-thf, calcium, belongs to the class of organic compounds known as tetrahydrofolic acids. These are heterocyclic compounds based on the 5,6,7,8-tetrahydropteroic acid skeleton conjugated with at least one L-glutamic acid unit. N5-Formyl-THF exists as a solid, possibly soluble (in water), and a moderately basic compound (based on its pKa) molecule. N5-Formyl-THF exists in all living species, ranging from bacteria to humans. N5-Formyl-THF participates in a number of enzymatic reactions, within cattle. In particular, N5-Formyl-THF and L-glutamic acid can be converted into tetrahydrofolic acid and N-formyl-L-glutamic acid; which is mediated by the enzyme formimidoyltransferase-cyclodeaminase. In addition, N5-Formyl-THF can be converted into 5,10-methenyltetrahydrofolic acid; which is catalyzed by the enzyme N5-formyl-thf cyclo-ligase. In cattle, N5-formyl-THF is involved in the metabolic pathway called the folate metabolism pathway. |
|---|
| Structure | |
|---|
| Synonyms | | Value | Source |
|---|
| Leucovorin | Kegg | | Rescuvolin | Kegg | | 5-Formyltetrahydrofolate | Kegg | | L(-)-5-Formyl-5,6,7,8-tetrahydrofolic acid | Kegg | | 5-Formyltetrahydrofolic acid | Generator | | L(-)-5-Formyl-5,6,7,8-tetrahydrofolate | Generator | | (6R,S)-5-Formyltetrahydrofolate | HMDB | | 10-Formyl-7,8-dihydrofolate | HMDB | | 10-Formyl-7,8-dihydrofolic acid | HMDB | | 5-Formyl-5,6,7,8-tetrahydrofolate | HMDB | | 5-Formyl-5,6,7,8-tetrahydrofolic acid | HMDB | | 5-Formyltetrahydropteroylglutamate | HMDB | | 5-Formyltetrahydropteroylglutamic acid | HMDB | | Folinate | HMDB, Generator | | Folinic acid | HMDB, MeSH | | Folinic acid-SF | HMDB | | L-Leucovorin | HMDB | | L-N-[P-[[(2-amino-5-Formyl-5,6,7,8-tetrahydro-4-hydroxy-6-pteridinyl)methyl]amino]benzoyl]-glutamic acid | HMDB | | Leucal | HMDB | | Levoleucovorin | HMDB | | N5-Formyl-5,6,7,8-tetrahydrofolate | HMDB | | N5-Formyl-5,6,7,8-tetrahydrofolic acid | HMDB | | N5-Formyltetrahydrofolate | HMDB | | N5-Formyltetrahydrofolic acid | HMDB | | Welcovorin | HMDB | | Acid, folinic | MeSH, HMDB | | Folinate, calcium | MeSH, HMDB | | Leucovorin, (D)-isomer | MeSH, HMDB | | Leucovorin, (DL)-isomer | MeSH, HMDB | | Leucovorin, calcium (1:1) salt | MeSH, HMDB | | 5 Formyltetrahydrofolate | MeSH, HMDB | | Citrovorum factor | MeSH, HMDB | | Factor, citrovorum | MeSH, HMDB | | Folinic acid SF | MeSH, HMDB | | Leucovorin, calcium (1:1) salt, pentahydrate | MeSH, HMDB | | Leukovorin | MeSH, HMDB | | N(5)-Formyltetrahydrofolate | MeSH, HMDB | | Leucovorin, (R)-isomer | MeSH, HMDB | | Leucovorin, calcium (1:1) salt, (DL)-isomer | MeSH, HMDB | | Leukovorum | MeSH, HMDB | | Monosodium salt leucovorin | MeSH, HMDB | | Wellcovorin | MeSH, HMDB | | 5 Formyltetrahydropteroylglutamate | MeSH, HMDB | | Calcium folinate | MeSH, HMDB | | Calcium leucovorin | MeSH, HMDB | | Leucovorin, calcium | MeSH, HMDB | | Leucovorin, monosodium salt | MeSH, HMDB | | 5-Formlyl-5,6,7,8-tetrahydrofolate,calcium salt | Generator |
|
|---|
| Chemical Formula | C20H23N7O7 |
|---|
| Average Molecular Weight | 473.4393 |
|---|
| Monoisotopic Molecular Weight | 473.165896125 |
|---|
| IUPAC Name | 2-[(4-{[(2-amino-5-formyl-4-oxo-3,4,5,6,7,8-hexahydropteridin-6-yl)methyl]amino}phenyl)formamido]pentanedioic acid |
|---|
| Traditional Name | 2-[(4-{[(2-amino-5-formyl-4-oxo-3,6,7,8-tetrahydropteridin-6-yl)methyl]amino}phenyl)formamido]pentanedioic acid |
|---|
| CAS Registry Number | 58-05-9 |
|---|
| SMILES | OC(=O)CCC(NC(=O)C1=CC=C(NCC2CNC3=C(N2C=O)C(O)=NC(=N)N3)C=C1)C(O)=O |
|---|
| InChI Identifier | InChI=1S/C20H23N7O7/c21-20-25-16-15(18(32)26-20)27(9-28)12(8-23-16)7-22-11-3-1-10(2-4-11)17(31)24-13(19(33)34)5-6-14(29)30/h1-4,9,12-13,22H,5-8H2,(H,24,31)(H,29,30)(H,33,34)(H4,21,23,25,26,32) |
|---|
| InChI Key | VVIAGPKUTFNRDU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | belongs to the class of organic compounds known as tetrahydrofolic acids. These are heterocyclic compounds based on the 5,6,7,8-tetrahydropteroic acid skeleton conjugated with at least one L-glutamic acid unit. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Organoheterocyclic compounds |
|---|
| Class | Pteridines and derivatives |
|---|
| Sub Class | Pterins and derivatives |
|---|
| Direct Parent | Tetrahydrofolic acids |
|---|
| Alternative Parents | |
|---|
| Substituents | - Tetrahydrofolic acid
- Glutamic acid or derivatives
- N-acyl-alpha amino acid or derivatives
- N-acyl-alpha-amino acid
- Hippuric acid
- Hippuric acid or derivatives
- Alpha-amino acid or derivatives
- Aminobenzamide
- Aminobenzoic acid or derivatives
- Benzamide
- Benzoic acid or derivatives
- Benzoyl
- Aniline or substituted anilines
- Phenylalkylamine
- Aminopyrimidine
- Secondary aliphatic/aromatic amine
- Pyrimidone
- Dicarboxylic acid or derivatives
- Benzenoid
- Pyrimidine
- Monocyclic benzene moiety
- Heteroaromatic compound
- Vinylogous amide
- Tertiary carboxylic acid amide
- Secondary carboxylic acid amide
- Amino acid or derivatives
- Amino acid
- Carboxamide group
- Secondary amine
- Carboxylic acid
- Carboxylic acid derivative
- Azacycle
- Organooxygen compound
- Carbonyl group
- Organic nitrogen compound
- Hydrocarbon derivative
- Amine
- Organic oxide
- Organopnictogen compound
- Organic oxygen compound
- Primary amine
- Organonitrogen compound
- Aromatic heteropolycyclic compound
|
|---|
| Molecular Framework | Aromatic heteropolycyclic compounds |
|---|
| External Descriptors | Not Available |
|---|
| Ontology |
|---|
| Status | Expected but not Quantified |
|---|
| Origin | Not Available |
|---|
| Biofunction | Not Available |
|---|
| Application | Not Available |
|---|
| Cellular locations | Not Available |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Predicted Properties | |
|---|
| Spectra |
|---|
| Spectra | |
|---|