| Record Information |
|---|
| Version | 1.0 |
|---|
| Creation Date | 2016-09-30 23:01:26 UTC |
|---|
| Update Date | 2020-05-11 20:55:57 UTC |
|---|
| BMDB ID | BMDB0002725 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Nandrolone |
|---|
| Description | Nandrolone, also known as decadura, belongs to the class of organic compounds known as estrogens and derivatives. These are steroids with a structure containing a 3-hydroxylated estrane. Thus, nandrolone is considered to be a steroid. Based on a literature review a significant number of articles have been published on Nandrolone. |
|---|
| Structure | |
|---|
| Synonyms | | Value | Source |
|---|
| (17beta)-17-Hydroxyestr-4-en-3-one | ChEBI | | 17beta-Hydroxy-19-nor-4-androsten-3-one | ChEBI | | 17beta-Hydroxy-4-estren-3-one | ChEBI | | 17beta-Hydroxyestr-4-en-3-one | ChEBI | | 19-Norandrostenolone | ChEBI | | 19-Nortestosterone | ChEBI | | 4-Estren-17beta-ol-3-one | ChEBI | | Decadura | Kegg | | (17b)-17-Hydroxyestr-4-en-3-one | Generator | | (17Β)-17-hydroxyestr-4-en-3-one | Generator | | 17b-Hydroxy-19-nor-4-androsten-3-one | Generator | | 17Β-hydroxy-19-nor-4-androsten-3-one | Generator | | 17b-Hydroxy-4-estren-3-one | Generator | | 17Β-hydroxy-4-estren-3-one | Generator | | 17b-Hydroxyestr-4-en-3-one | Generator | | 17Β-hydroxyestr-4-en-3-one | Generator | | 4-Estren-17b-ol-3-one | Generator | | 4-Estren-17β-ol-3-one | Generator | | (17-beta)-17-Hydroxyestr-4-en-3-one | HMDB | | 17-beta-Hydroestr-4-en-3-one | HMDB | | Deca-durabolin | HMDB | | Durabolin | HMDB | | Menidrabol | HMDB | | Nandrolon | HMDB | | Nandrolona | HMDB | | Nandrolone base | HMDB | | Nandrolone decanoate | HMDB | | Nandrolone decanoic acid | HMDB | | Nandrolone phenpropionate | HMDB | | Nandrolonum | HMDB | | Norandrostenolon | HMDB | | Norandrostenolone | HMDB | | Nortestonate | HMDB | | Nortestosterone | HMDB | | Nortestosteronum | HMDB | | Oestrenolon | HMDB | | 17-Hydroxy-estr-4-ene-3-one | MeSH, HMDB | | Estrenolone | MeSH, HMDB | | 17beta Hydroxy 19 nor 4 androsten 3 one | MeSH, HMDB |
|
|---|
| Chemical Formula | C18H26O2 |
|---|
| Average Molecular Weight | 274.3978 |
|---|
| Monoisotopic Molecular Weight | 274.193280076 |
|---|
| IUPAC Name | (1S,2R,10R,11S,14S,15S)-14-hydroxy-15-methyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadec-6-en-5-one |
|---|
| Traditional Name | (1S,2R,10R,11S,14S,15S)-14-hydroxy-15-methyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadec-6-en-5-one |
|---|
| CAS Registry Number | 434-22-0 |
|---|
| SMILES | [H][C@@]12CC[C@H](O)[C@@]1(C)CC[C@]1([H])[C@@]3([H])CCC(=O)C=C3CC[C@@]21[H] |
|---|
| InChI Identifier | InChI=1S/C18H26O2/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20/h10,13-17,20H,2-9H2,1H3/t13-,14+,15+,16-,17-,18-/m0/s1 |
|---|
| InChI Key | NPAGDVCDWIYMMC-IZPLOLCNSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | belongs to the class of organic compounds known as estrogens and derivatives. These are steroids with a structure containing a 3-hydroxylated estrane. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Lipids and lipid-like molecules |
|---|
| Class | Steroids and steroid derivatives |
|---|
| Sub Class | Estrane steroids |
|---|
| Direct Parent | Estrogens and derivatives |
|---|
| Alternative Parents | |
|---|
| Substituents | - Estrogen-skeleton
- 3-oxo-delta-4-steroid
- 3-oxosteroid
- 17-hydroxysteroid
- Oxosteroid
- Hydroxysteroid
- Delta-4-steroid
- Cyclohexenone
- Cyclic alcohol
- Cyclic ketone
- Secondary alcohol
- Ketone
- Organic oxygen compound
- Hydrocarbon derivative
- Carbonyl group
- Organic oxide
- Organooxygen compound
- Alcohol
- Aliphatic homopolycyclic compound
|
|---|
| Molecular Framework | Aliphatic homopolycyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Status | Expected but not Quantified |
|---|
| Origin | |
|---|
| Biofunction | Not Available |
|---|
| Application | Not Available |
|---|
| Cellular locations | - Cell membrane
- Cytoplasm
- Membrane
|
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Properties | | Property | Value | Reference |
|---|
| Melting Point | 118 °C | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | 3.09 mg/mL at 25 °C | Not Available | | LogP | 2.62 | HANSCH,C ET AL. (1995) |
|
|---|
| Predicted Properties | |
|---|
| Spectra |
|---|
| Spectra | |
|---|
