| Record Information |
|---|
| Version | 1.0 |
|---|
| Creation Date | 2016-09-30 23:05:00 UTC |
|---|
| Update Date | 2020-05-21 16:29:05 UTC |
|---|
| BMDB ID | BMDB0003514 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Alpha-D-Glucose 1,6-bisphosphate |
|---|
| Description | Alpha-D-Alpha-d-alpha-d-glucose 1,6-bisphosphate, also known as α-Alphalpha-d-alpha-d-glucose 1,6-bisphosphate or alpha-d-glucose 1,6-bisphosphate, belongs to the class of organic compounds known as hexose phosphates. These are carbohydrate derivatives containing a hexose substituted by one or more phosphate groups. Alpha-D-Alpha-d-alpha-d-glucose 1,6-bisphosphate is possibly soluble (in water) and an extremely weak basic (essentially neutral) compound (based on its pKa). Alpha-D-Alpha-d-alpha-d-glucose 1,6-bisphosphate exists in all living species, ranging from bacteria to humans. Alpha-D-Alpha-d-alpha-d-glucose 1,6-bisphosphate and 3-phosphoglyceric acid can be biosynthesized from glucose 1-phosphate and glyceric acid 1,3-biphosphate through the action of the enzyme alpha-d-glucose 1,6-bisphosphate synthase. In cattle, Alpha-Alpha-alphalpha-d-alpha-d-glucose 1,6-bisphosphate is involved in the metabolic pathway called the starch and sucrose metabolism pathway. |
|---|
| Structure | |
|---|
| Synonyms | | Value | Source |
|---|
| alpha-D-Glucose 1,6-biphosphate | ChEBI | | D-Glucose 1,6-biphosphate | ChEBI | | D-Glucose 1,6-bisphosphate | Kegg | | a-D-Glucose 1,6-biphosphate | Generator | | a-D-Glucose 1,6-biphosphoric acid | Generator | | alpha-D-Glucose 1,6-biphosphoric acid | Generator | | Α-D-glucose 1,6-biphosphate | Generator | | Α-D-glucose 1,6-biphosphoric acid | Generator | | D-Glucose 1,6-biphosphoric acid | Generator | | D-Glucose 1,6-bisphosphoric acid | Generator | | a-D-Glucose 1,6-bisphosphate | Generator | | a-D-Glucose 1,6-bisphosphoric acid | Generator | | alpha-D-Glucose 1,6-bisphosphoric acid | Generator | | Α-D-glucose 1,6-bisphosphate | Generator | | Α-D-glucose 1,6-bisphosphoric acid | Generator | | a-D-Glucose 1,6-bis(dihydrogen phosphate) | HMDB | | a-D-Glucose 1,6-diphosphate | HMDB | | alpha-D-1,6-Bis(dihydrogen phosphate) glucopyranose | HMDB | | alpha-D-Glucose 1,6-bis(dihydrogen phosphate) | HMDB | | alpha-D-Glucose 1,6-diphosphate | HMDB | | alpha-delta-1,6-Bis(dihydrogen phosphate) glucopyranose | HMDB | | alpha-delta-Glucose 1,6-bis(dihydrogen phosphate) | HMDB | | alpha-delta-Glucose 1,6-bisphosphate | HMDB | | alpha-delta-Glucose 1,6-diphosphate | HMDB | | D-Glucose 1,6-diphosphate | HMDB | | delta-Glucose 1,6-diphosphate | HMDB | | Glucose 1,6-bisphosphate | HMDB | | Glucose 1,6-diphosphate | HMDB | | beta-D-Glucose 1,6-(bis)phosphate | HMDB | | Glucose-1,6-diphosphate | HMDB | | Glucose-1,6-bisphosphate | HMDB | | alpha-Glucose 1,6-diphosphate | HMDB | | Α-D-glucose 1,6-diphosphate | HMDB | | Α-glucose 1,6-diphosphate | HMDB | | alpha-D-Glucose 1,6-bisphosphate | HMDB |
|
|---|
| Chemical Formula | C6H14O12P2 |
|---|
| Average Molecular Weight | 340.1157 |
|---|
| Monoisotopic Molecular Weight | 339.996048936 |
|---|
| IUPAC Name | {[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[(phosphonooxy)methyl]oxan-2-yl]oxy}phosphonic acid |
|---|
| Traditional Name | [(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[(phosphonooxy)methyl]oxan-2-yl]oxyphosphonic acid |
|---|
| CAS Registry Number | 10139-18-1 |
|---|
| SMILES | O[C@H]1[C@H](O)[C@@H](COP(O)(O)=O)O[C@H](OP(O)(O)=O)[C@@H]1O |
|---|
| InChI Identifier | InChI=1S/C6H14O12P2/c7-3-2(1-16-19(10,11)12)17-6(5(9)4(3)8)18-20(13,14)15/h2-9H,1H2,(H2,10,11,12)(H2,13,14,15)/t2-,3-,4+,5-,6-/m1/s1 |
|---|
| InChI Key | RWHOZGRAXYWRNX-VFUOTHLCSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | belongs to the class of organic compounds known as hexose phosphates. These are carbohydrate derivatives containing a hexose substituted by one or more phosphate groups. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Organic oxygen compounds |
|---|
| Class | Organooxygen compounds |
|---|
| Sub Class | Carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | Hexose phosphates |
|---|
| Alternative Parents | |
|---|
| Substituents | - Hexose phosphate
- Monosaccharide phosphate
- Monoalkyl phosphate
- Alkyl phosphate
- Phosphoric acid ester
- Oxane
- Organic phosphoric acid derivative
- Secondary alcohol
- Oxacycle
- Organoheterocyclic compound
- Polyol
- Organic oxide
- Hydrocarbon derivative
- Alcohol
- Aliphatic heteromonocyclic compound
|
|---|
| Molecular Framework | Aliphatic heteromonocyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Status | Expected but not Quantified |
|---|
| Origin | |
|---|
| Biofunction | Not Available |
|---|
| Application | Not Available |
|---|
| Cellular locations | Not Available |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | -4.374 | Not Available |
|
|---|
| Predicted Properties | |
|---|
| Spectra |
|---|
| Spectra | |
|---|