| Record Information |
|---|
| Version | 1.0 |
|---|
| Creation Date | 2016-09-30 23:06:10 UTC |
|---|
| Update Date | 2020-04-22 15:12:46 UTC |
|---|
| BMDB ID | BMDB0003822 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Cholesteryl acetate |
|---|
| Description | 2-Methylacetoacetic acid, also known as 2-methyl-3-oxo-butyric acid or 2-acetylpropionic acid, belongs to the class of organic compounds known as short-chain keto acids and derivatives. These are keto acids with an alkyl chain the contains less than 6 carbon atoms. 2-Methylacetoacetic acid is an extremely weak basic (essentially neutral) compound (based on its pKa). 2-Methylacetoacetic acid, with regard to humans, has been linked to the inborn metabolic disorder beta-ketothiolase deficiency. |
|---|
| Structure | |
|---|
| Synonyms | | Value | Source |
|---|
| 2-Methylacetoacetate | Generator | | 2-Methyl-3-oxo-butyric acid | HMDB | | 2-Methyl-3-oxo-butyrate | HMDB | | 2Methyl-3-ketovalerate | HMDB | | (+/-)-2-methyl-3-oxobutanoate | HMDB | | (+/-)-2-methyl-3-oxobutanoic acid | HMDB | | 2-Acetylpropionic acid | HMDB | | 2-Methyl-3-ketobutyric acid | HMDB | | 2-Methyl-3-oxo-butanoate | HMDB | | 2-Methyl-3-oxo-butanoic acid | HMDB | | 2-Methyl-3-oxobutanoate | HMDB | | 2-Methyl-3-oxobutanoic acid | HMDB | | 2-Methyl-3-oxobutyric acid | HMDB | | 2-Methyl-acetoacetic acid | HMDB | | 3-oxo-2-Methylbutyric acid | HMDB | | a-Methylacetoacetic acid | HMDB | | alpha-Methylacetoacetate | HMDB | | alpha-Methylacetoacetic acid | HMDB | | (-)-2-Methyl-3-oxobutanoic acid | HMDB | | (2S)-2-Methyl-3-oxobutanoic acid | HMDB | | (S)-2-Acetylpropionic acid | HMDB | | (S)-2-Methyl-3-oxobutyric acid | HMDB | | (±)-2-methyl-3-oxobutanoic acid | HMDB | | 3-Keto-2-methylbutyrate | HMDB | | 3-Keto-2-methylbutyric acid | HMDB | | Α-methylacetoacetic acid | HMDB | | (-)-Cholesteryl acetate | HMDB | | (3b)-Cholest-5-en-3-ol acetate | HMDB | | 3-Cholesteryl acetate | HMDB | | 3b-Acetoxycholest-5-ene | HMDB | | Cholest-5-en-3b-ol acetate | HMDB | | Cholest-5-en-3b-yl acetate | HMDB | | Cholesterin acetate | HMDB | | Cholesterol 3-acetate | HMDB | | Cholesterol 3b-acetate | HMDB | | Cholesterol acetate | HMDB | | (2R,5S,15R)-2,15-Dimethyl-14-[(2R)-6-methylheptan-2-yl]tetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadec-7-en-5-yl acetic acid | Generator, HMDB | | Cholesteryl acetate | MeSH | | Cholesteryl acetic acid | Generator |
|
|---|
| Chemical Formula | C29H48O2 |
|---|
| Average Molecular Weight | 428.6902 |
|---|
| Monoisotopic Molecular Weight | 428.36543078 |
|---|
| IUPAC Name | (2R,5S,15R)-2,15-dimethyl-14-[(2R)-6-methylheptan-2-yl]tetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadec-7-en-5-yl acetate |
|---|
| Traditional Name | (2R,5S,15R)-2,15-dimethyl-14-[(2R)-6-methylheptan-2-yl]tetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadec-7-en-5-yl acetate |
|---|
| CAS Registry Number | 604-35-3 |
|---|
| SMILES | CC(C)CCC[C@@H](C)C1CCC2C3CC=C4C[C@H](CC[C@]4(C)C3CC[C@]12C)OC(C)=O |
|---|
| InChI Identifier | InChI=1S/C29H48O2/c1-19(2)8-7-9-20(3)25-12-13-26-24-11-10-22-18-23(31-21(4)30)14-16-28(22,5)27(24)15-17-29(25,26)6/h10,19-20,23-27H,7-9,11-18H2,1-6H3/t20-,23+,24?,25?,26?,27?,28+,29-/m1/s1 |
|---|
| InChI Key | XUGISPSHIFXEHZ-JUTJDYIZSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | belongs to the class of organic compounds known as short-chain keto acids and derivatives. These are keto acids with an alkyl chain the contains less than 6 carbon atoms. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Organic acids and derivatives |
|---|
| Class | Keto acids and derivatives |
|---|
| Sub Class | Short-chain keto acids and derivatives |
|---|
| Direct Parent | Short-chain keto acids and derivatives |
|---|
| Alternative Parents | |
|---|
| Substituents | - Beta-keto acid
- Branched fatty acid
- Methyl-branched fatty acid
- Short-chain keto acid
- Beta-hydroxy ketone
- Fatty acyl
- 1,3-dicarbonyl compound
- Ketone
- Carboxylic acid derivative
- Carboxylic acid
- Monocarboxylic acid or derivatives
- Carbonyl group
- Hydrocarbon derivative
- Organic oxygen compound
- Organooxygen compound
- Organic oxide
- Aliphatic acyclic compound
|
|---|
| Molecular Framework | Aliphatic acyclic compounds |
|---|
| External Descriptors | Not Available |
|---|
| Ontology |
|---|
| Status | Expected but not Quantified |
|---|
| Origin | |
|---|
| Biofunction | Not Available |
|---|
| Application | Not Available |
|---|
| Cellular locations | - Cell membrane
- Cytoplasm
- Membrane
|
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Predicted Properties | |
|---|
| Spectra |
|---|
| Spectra | |
|---|