| Record Information |
|---|
| Version | 1.0 |
|---|
| Creation Date | 2016-09-30 23:07:45 UTC |
|---|
| Update Date | 2020-04-22 15:13:16 UTC |
|---|
| BMDB ID | BMDB0004080 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Anandamide |
|---|
| Description | Anandamide, also known as AEA, belongs to the class of organic compounds known as n-acylethanolamines. N-acylethanolamines are compounds containing an N-acyethanolamine moiety, which is characterized by an acyl group is linked to the nitrogen atom of ethanolamine. Thus, anandamide is considered to be a fatty amide lipid molecule. Anandamide is a very hydrophobic molecule, practically insoluble (in water), and relatively neutral. |
|---|
| Structure | |
|---|
| Synonyms | | Value | Source |
|---|
| (5Z,8Z,11Z,14Z)-N-(2-Hydroxyethyl)-5,8,11,14-eicosatetraenamide | ChEBI | | (all-Z)-N-(2-Hydroxyethyl)-5,8,11,14-eicosatetraenamide | ChEBI | | AEA | ChEBI | | Anandamide (20.4, N-6) | ChEBI | | Anandamide(20:4, N-6) | ChEBI | | Arachidonic acid N-(hydroxyethyl)amide | ChEBI | | Arachidonoyl ethanolamide | ChEBI | | Arachidonylethanolamide | ChEBI | | N-(2-Hydroxyethyl)anachidonamide | ChEBI | | N-(5Z,8Z,11Z,14Z-Eicosatetraenoyl)-ethanolamine | ChEBI | | N-(5Z,8Z,11Z,14Z-Icosatetraenoyl)-ethanolamide | ChEBI | | N-Arachidonoyl ethanolamine | ChEBI | | N-Arachidonoyl-2-hydroxyethylamide | ChEBI | | N-Arachidonoylethanolamine | ChEBI | | Arachidonate N-(hydroxyethyl)amide | Generator | | N-(5Z,8Z,11Z,14Z-Eicosatetraenoyl) ethanolamine | HMDB | | 5,8,11,14-Eicosatetraenoylethanolamide | HMDB | | N-(2-Hydroxyethyl)-5,8,11,14-eicosatetraenamide (all-Z) | HMDB | | N-(2-Hydroxyethyl)arachidonamide | HMDB | | Anandamide (20.4,N-6) | HMDB | | Arachidonoylethanolamide | HMDB | | N-Arachidonoylethanolamide | HMDB | | Anandamide | MeSH | | N-(2-Hydroxyethyl)arachidonylamide | HMDB | | N-Arachidonylethanolamide | HMDB | | N-Arachidonylethanolamine | HMDB | | AEA(22:6) | HMDB | | Acylethanolamine 22:6 | HMDB |
|
|---|
| Chemical Formula | C22H37NO2 |
|---|
| Average Molecular Weight | 347.5347 |
|---|
| Monoisotopic Molecular Weight | 347.282429433 |
|---|
| IUPAC Name | (5Z,8Z,11Z,14Z)-N-(2-hydroxyethyl)icosa-5,8,11,14-tetraenamide |
|---|
| Traditional Name | anandamide |
|---|
| CAS Registry Number | 94421-68-8 |
|---|
| SMILES | CCCCC\C=C/C\C=C/C\C=C/C\C=C/CCCC(=O)NCCO |
|---|
| InChI Identifier | InChI=1S/C22H37NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(25)23-20-21-24/h6-7,9-10,12-13,15-16,24H,2-5,8,11,14,17-21H2,1H3,(H,23,25)/b7-6-,10-9-,13-12-,16-15- |
|---|
| InChI Key | LGEQQWMQCRIYKG-DOFZRALJSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | belongs to the class of organic compounds known as n-acylethanolamines. N-acylethanolamines are compounds containing an N-acyethanolamine moiety, which is characterized by an acyl group is linked to the nitrogen atom of ethanolamine. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Organic nitrogen compounds |
|---|
| Class | Organonitrogen compounds |
|---|
| Sub Class | Amines |
|---|
| Direct Parent | N-acylethanolamines |
|---|
| Alternative Parents | |
|---|
| Substituents | - N-acylethanolamine
- Fatty amide
- N-acyl-amine
- Fatty acyl
- Carboxamide group
- Secondary carboxylic acid amide
- Carboxylic acid derivative
- Alcohol
- Organooxygen compound
- Primary alcohol
- Hydrocarbon derivative
- Organic oxide
- Organopnictogen compound
- Organic oxygen compound
- Carbonyl group
- Aliphatic acyclic compound
|
|---|
| Molecular Framework | Aliphatic acyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Status | Expected but not Quantified |
|---|
| Origin | |
|---|
| Biofunction | Not Available |
|---|
| Application | Not Available |
|---|
| Cellular locations | |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Predicted Properties | |
|---|
| Spectra |
|---|
| Spectra | |
|---|
| Synthesis Reference | Qi, Longwu; Meijler, Michael M.; Lee, Sang-Hyeup; Sun, Chengzao; Janda, Kim D. Solid-Phase Synthesis of Anandamide Analogues. Organic Letters (2004), 6(10), 1673-1675. |
|---|