| Record Information |
|---|
| Version | 1.0 |
|---|
| Creation Date | 2016-09-30 23:10:26 UTC |
|---|
| Update Date | 2020-04-22 15:14:05 UTC |
|---|
| BMDB ID | BMDB0004702 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | 12,13-EpOME |
|---|
| Description | 12,13-EpOME, also known as vernolsaeure or vernolic acids, belongs to the class of organic compounds known as long-chain fatty acids. These are fatty acids with an aliphatic tail that contains between 13 and 21 carbon atoms. Thus, 12,13-epome is considered to be an octadecanoid lipid molecule. 12,13-EpOME is a very hydrophobic molecule, practically insoluble (in water), and relatively neutral. |
|---|
| Structure | |
|---|
| Synonyms | | Value | Source |
|---|
| (9Z)-11-(3-Pentyloxiran-2-yl)undec-9-enoic acids | ChEBI | | (9Z)-12,13-Epoxyoctadecenoic acid | ChEBI | | 12(13)-EpOME | ChEBI | | 12,13-cis-Epoxyoctadecenoic acid | ChEBI | | 12,13-Epoxy-9(Z)-octadecenoic acid | ChEBI | | 12,13-Epoxy-cis-9-octadecenoic acid | ChEBI | | 12,13-Monoepoxy-cis-9-octadecenoic acid | ChEBI | | Acide vernolique | ChEBI | | cis-12,13-Ep, 9C-18:1 | ChEBI | | cis-12,13-Epoxy-9-octadecenoic acid | ChEBI | | Vernolic acids | ChEBI | | Vernolsaeure | ChEBI | | Vernolsaeuren | ChEBI | | (9Z)-12,13-Epoxyoctadecenoate | Generator | | 12,13-cis-Epoxyoctadecenoate | Generator | | 12,13-Epoxy-9(Z)-octadecenoate | Generator | | 12,13-Epoxy-cis-9-octadecenoate | Generator | | 12,13-Monoepoxy-cis-9-octadecenoate | Generator | | cis-12,13-Epoxy-9-octadecenoate | Generator | | (+/-)-12(13)-epoxy-9Z-octadecenoate | HMDB | | (+/-)-12(13)-epoxy-9Z-octadecenoic acid | HMDB | | (9Z)-11-(3-Pentyloxiran-2-yl)undec-9-enoate | HMDB | | (9Z)-11-(3-Pentyloxiran-2-yl)undec-9-enoic acid | HMDB | | 12,13-Epoxyoctadec-9(Z)-enoate | HMDB | | 12,13-Epoxyoctadec-9(Z)-enoic acid | HMDB | | Vernolic acid | HMDB | | cis-12-Epoxyoctadeca-cis-9-enoate | HMDB | | cis-12-Epoxyoctadeca-cis-9-enoic acid | HMDB | | Vernoleate | HMDB | | 12,13-EOA | HMDB | | 12,13-Epoxy-9-octadecenoic acid | HMDB | | Vernolate | HMDB |
|
|---|
| Chemical Formula | C18H32O3 |
|---|
| Average Molecular Weight | 296.4449 |
|---|
| Monoisotopic Molecular Weight | 296.23514489 |
|---|
| IUPAC Name | (9Z)-11-(3-pentyloxiran-2-yl)undec-9-enoic acid |
|---|
| Traditional Name | vernolic acid |
|---|
| CAS Registry Number | Not Available |
|---|
| SMILES | CCCCCC1OC1C\C=C/CCCCCCCC(O)=O |
|---|
| InChI Identifier | InChI=1S/C18H32O3/c1-2-3-10-13-16-17(21-16)14-11-8-6-4-5-7-9-12-15-18(19)20/h8,11,16-17H,2-7,9-10,12-15H2,1H3,(H,19,20)/b11-8- |
|---|
| InChI Key | CCPPLLJZDQAOHD-FLIBITNWSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | belongs to the class of organic compounds known as long-chain fatty acids. These are fatty acids with an aliphatic tail that contains between 13 and 21 carbon atoms. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Lipids and lipid-like molecules |
|---|
| Class | Fatty Acyls |
|---|
| Sub Class | Fatty acids and conjugates |
|---|
| Direct Parent | Long-chain fatty acids |
|---|
| Alternative Parents | |
|---|
| Substituents | - Long-chain fatty acid
- Epoxy fatty acid
- Heterocyclic fatty acid
- Unsaturated fatty acid
- Carboxylic acid derivative
- Carboxylic acid
- Dialkyl ether
- Oxirane
- Ether
- Monocarboxylic acid or derivatives
- Organoheterocyclic compound
- Oxacycle
- Organic oxide
- Hydrocarbon derivative
- Carbonyl group
- Organooxygen compound
- Organic oxygen compound
- Aliphatic heteromonocyclic compound
|
|---|
| Molecular Framework | Aliphatic heteromonocyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Status | Expected but not Quantified |
|---|
| Origin | |
|---|
| Biofunction | Not Available |
|---|
| Application | Not Available |
|---|
| Cellular locations | - Adiposome
- Cell membrane
- Cytoplasm
- Membrane
|
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Predicted Properties | |
|---|
| Spectra |
|---|
| Spectra | |
|---|