| Record Information |
|---|
| Version | 1.0 |
|---|
| Creation Date | 2016-09-30 23:14:53 UTC |
|---|
| Update Date | 2020-05-11 20:49:34 UTC |
|---|
| BMDB ID | BMDB0005034 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Topiramate |
|---|
| Description | Topiramate, also known as topamax or MCN-4853, belongs to the class of organic compounds known as dioxolopyrans. Dioxolopyrans are compounds containing a dioxolopyran moiety, which consists of a dioxole ring fused to a pyran ring. Topiramate is an extremely weak basic (essentially neutral) compound (based on its pKa). Topiramate is a potentially toxic compound. |
|---|
| Structure | |
|---|
| Synonyms | | Value | Source |
|---|
| 2,3:4,5-Bis-O-(1-methylethylidene)-beta-D-fructopyranose sulfamate | ChEBI | | 2,3:4,5-Di-O-isopropylidene-beta-D-fructopyranose sulfamate | ChEBI | | MCN-4853 | ChEBI | | RWJ-17021 | ChEBI | | Tipiramate | ChEBI | | Tipiramato | ChEBI | | Topamax | ChEBI | | Topiramato | ChEBI | | Topiramatum | ChEBI | | TPM | ChEBI | | Trokendi XR | Kegg | | 2,3:4,5-Bis-O-(1-methylethylidene)-b-D-fructopyranose sulfamate | Generator | | 2,3:4,5-Bis-O-(1-methylethylidene)-b-D-fructopyranose sulfamic acid | Generator | | 2,3:4,5-Bis-O-(1-methylethylidene)-b-D-fructopyranose sulphamate | Generator | | 2,3:4,5-Bis-O-(1-methylethylidene)-b-D-fructopyranose sulphamic acid | Generator | | 2,3:4,5-Bis-O-(1-methylethylidene)-beta-D-fructopyranose sulfamic acid | Generator | | 2,3:4,5-Bis-O-(1-methylethylidene)-beta-D-fructopyranose sulphamate | Generator | | 2,3:4,5-Bis-O-(1-methylethylidene)-beta-D-fructopyranose sulphamic acid | Generator | | 2,3:4,5-Bis-O-(1-methylethylidene)-β-D-fructopyranose sulfamate | Generator | | 2,3:4,5-Bis-O-(1-methylethylidene)-β-D-fructopyranose sulfamic acid | Generator | | 2,3:4,5-Bis-O-(1-methylethylidene)-β-D-fructopyranose sulphamate | Generator | | 2,3:4,5-Bis-O-(1-methylethylidene)-β-D-fructopyranose sulphamic acid | Generator | | 2,3:4,5-Di-O-isopropylidene-b-D-fructopyranose sulfamate | Generator | | 2,3:4,5-Di-O-isopropylidene-b-D-fructopyranose sulfamic acid | Generator | | 2,3:4,5-Di-O-isopropylidene-b-D-fructopyranose sulphamate | Generator | | 2,3:4,5-Di-O-isopropylidene-b-D-fructopyranose sulphamic acid | Generator | | 2,3:4,5-Di-O-isopropylidene-beta-D-fructopyranose sulfamic acid | Generator | | 2,3:4,5-Di-O-isopropylidene-beta-D-fructopyranose sulphamate | Generator | | 2,3:4,5-Di-O-isopropylidene-beta-D-fructopyranose sulphamic acid | Generator | | 2,3:4,5-Di-O-isopropylidene-β-D-fructopyranose sulfamate | Generator | | 2,3:4,5-Di-O-isopropylidene-β-D-fructopyranose sulfamic acid | Generator | | 2,3:4,5-Di-O-isopropylidene-β-D-fructopyranose sulphamate | Generator | | 2,3:4,5-Di-O-isopropylidene-β-D-fructopyranose sulphamic acid | Generator | | Tipiramic acid | Generator | | Topiramic acid | Generator | | Epitomax | HMDB | | Topamax sprinkle | HMDB | | Topomax | HMDB | | 2,3-4,5-Bis-O-(1-methylethylidene)-beta-D-fructopyranose sulfamate | HMDB |
|
|---|
| Chemical Formula | C12H21NO8S |
|---|
| Average Molecular Weight | 339.362 |
|---|
| Monoisotopic Molecular Weight | 339.098787343 |
|---|
| IUPAC Name | [(1R,2S,6S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.0²,⁶]dodecan-6-yl]methyl sulfamate |
|---|
| Traditional Name | topiramate |
|---|
| CAS Registry Number | 97240-79-4 |
|---|
| SMILES | [H][C@@]12CO[C@@]3(COS(N)(=O)=O)OC(C)(C)O[C@@]3([H])[C@]1([H])OC(C)(C)O2 |
|---|
| InChI Identifier | InChI=1S/C12H21NO8S/c1-10(2)18-7-5-16-12(6-17-22(13,14)15)9(8(7)19-10)20-11(3,4)21-12/h7-9H,5-6H2,1-4H3,(H2,13,14,15)/t7-,8-,9+,12+/m1/s1 |
|---|
| InChI Key | KJADKKWYZYXHBB-XBWDGYHZSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | belongs to the class of organic compounds known as dioxolopyrans. Dioxolopyrans are compounds containing a dioxolopyran moiety, which consists of a dioxole ring fused to a pyran ring. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Organoheterocyclic compounds |
|---|
| Class | Dioxolopyrans |
|---|
| Sub Class | Not Available |
|---|
| Direct Parent | Dioxolopyrans |
|---|
| Alternative Parents | |
|---|
| Substituents | - Dioxolopyran
- Ketal
- Oxane
- Monosaccharide
- Organic sulfuric acid or derivatives
- Meta-dioxolane
- Oxacycle
- Acetal
- Organic nitrogen compound
- Organic oxygen compound
- Organic oxide
- Hydrocarbon derivative
- Organooxygen compound
- Aliphatic heteropolycyclic compound
|
|---|
| Molecular Framework | Aliphatic heteropolycyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Status | Expected but not Quantified |
|---|
| Origin | |
|---|
| Biofunction | Not Available |
|---|
| Application | Not Available |
|---|
| Cellular locations | |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Properties | | Property | Value | Reference |
|---|
| Melting Point | 125 - 126 °C | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Predicted Properties | |
|---|
| Spectra |
|---|
| Spectra | |
|---|