| Record Information |
|---|
| Version | 1.0 |
|---|
| Creation Date | 2016-09-30 23:17:34 UTC |
|---|
| Update Date | 2020-06-04 20:30:47 UTC |
|---|
| BMDB ID | BMDB0005453 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | TG(18:1(9Z)/18:1(9Z)/18:1(9Z))[iso] |
|---|
| Description | TG(18:1(9Z)/18:1(9Z)/18:1(9Z)), also known as glycerol triolein or oleic acid triglyceride, belongs to the class of organic compounds known as triacylglycerols. These are glycerides consisting of three fatty acid chains covalently bonded to a glycerol molecule through ester linkages. Thus, TG(18:1(9Z)/18:1(9Z)/18:1(9Z)) is considered to be a triradylglycerol lipid molecule. TG(18:1(9Z)/18:1(9Z)/18:1(9Z)) exists as a solid, very hydrophobic, practically insoluble (in water), and relatively neutral molecule. TG(18:1(9Z)/18:1(9Z)/18:1(9Z)) exists in all eukaryotes, ranging from yeast to humans. In cattle, TG(18:1(9Z)/18:1(9Z)/18:1(9Z)) is involved in the metabolic pathway called de novo triacylglycerol biosynthesis TG(18:1(9Z)/18:1(9Z)/18:1(9Z)) pathway. |
|---|
| Structure | |
|---|
| Synonyms | | Value | Source |
|---|
| (Z)-9-Octadecenoic acid, 1,2,3-propanetriyl ester | ChEBI | | 1,2,3-Tri-(9Z-octadecenoyl)-glycerol | ChEBI | | Glycerin trioleate | ChEBI | | Glycerol trioleate | ChEBI | | Glycerol triolein | ChEBI | | Glycerol, tri(cis-9-octadecenoate) | ChEBI | | Glyceryl trioleate | ChEBI | | Glyceryl-1,2,3-trioleate | ChEBI | | Oleic acid triglyceride | ChEBI | | Oleic triglyceride | ChEBI | | Olein | ChEBI | | Oleyl triglyceride | ChEBI | | Propane-1,2,3-triyl (9Z,9'z,9''z)tris-octadec-9-enoate | ChEBI | | TG(18:1(9Z)/18:1(9Z)/18:1(9Z))[iso] | ChEBI | | Trioleoylglyceride | ChEBI | | Trioleoylglycerol | ChEBI | | (Z)-9-Octadecenoate, 1,2,3-propanetriyl ester | Generator | | Glycerin trioleic acid | Generator | | Glycerol trioleic acid | Generator | | Glycerol, tri(cis-9-octadecenoic acid) | Generator | | Glyceryl trioleic acid | Generator | | Glyceryl-1,2,3-trioleic acid | Generator | | Oleate triglyceride | Generator | | Propane-1,2,3-triyl (9Z,9'z,9''z)tris-octadec-9-enoic acid | Generator | | Glycerol, trioleyl | MeSH | | Trioleate, glycerol | MeSH | | Trioleate-glycerin | MeSH | | Trielaidin | MeSH | | Trioleate glycerin | MeSH | | Trioleyl glycerol | MeSH | | Triacylglycerol | Lipid Annotator, HMDB | | TG(18:1/18:1/18:1) | Lipid Annotator, HMDB | | TG(54:3) | Lipid Annotator, HMDB | | TG(18:1(9Z)/18:1(9Z)/18:1(9Z)) | Lipid Annotator | | Tracylglycerol(18:1/18:1/18:1) | Lipid Annotator, HMDB | | Triglyceride | Lipid Annotator, HMDB | | Tracylglycerol(54:3) | Lipid Annotator, HMDB | | 1-oleoyl-2-oleoyl-3-oleoyl-glycerol | Lipid Annotator, HMDB | | TAG(54:3) | Lipid Annotator, HMDB | | 1-(9Z-octadecenoyl)-2-(9Z-octadecenoyl)-3-(9Z-octadecenoyl)-glycerol | Lipid Annotator, HMDB | | TAG(18:1/18:1/18:1) | Lipid Annotator, HMDB | | Triolein | MeSH |
|
|---|
| Chemical Formula | C57H104O6 |
|---|
| Average Molecular Weight | 885.4321 |
|---|
| Monoisotopic Molecular Weight | 884.78329106 |
|---|
| IUPAC Name | 1,3-bis[(9Z)-octadec-9-enoyloxy]propan-2-yl (9Z)-octadec-9-enoate |
|---|
| Traditional Name | triolein |
|---|
| CAS Registry Number | 122-32-7 |
|---|
| SMILES | [H]C(COC(=O)CCCCCCC\C=C/CCCCCCCC)(COC(=O)CCCCCCC\C=C/CCCCCCCC)OC(=O)CCCCCCC\C=C/CCCCCCCC |
|---|
| InChI Identifier | InChI=1S/C57H104O6/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-46-49-55(58)61-52-54(63-57(60)51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-3)53-62-56(59)50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-5-2/h25-30,54H,4-24,31-53H2,1-3H3/b28-25-,29-26-,30-27- |
|---|
| InChI Key | PHYFQTYBJUILEZ-IUPFWZBJSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | belongs to the class of organic compounds known as triacylglycerols. These are glycerides consisting of three fatty acid chains covalently bonded to a glycerol molecule through ester linkages. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Lipids and lipid-like molecules |
|---|
| Class | Glycerolipids |
|---|
| Sub Class | Triradylcglycerols |
|---|
| Direct Parent | Triacylglycerols |
|---|
| Alternative Parents | |
|---|
| Substituents | - Triacyl-sn-glycerol
- Tricarboxylic acid or derivatives
- Fatty acid ester
- Fatty acyl
- Carboxylic acid ester
- Carboxylic acid derivative
- Organic oxygen compound
- Organic oxide
- Hydrocarbon derivative
- Organooxygen compound
- Carbonyl group
- Aliphatic acyclic compound
|
|---|
| Molecular Framework | Aliphatic acyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Status | Detected and Quantified |
|---|
| Origin | |
|---|
| Biofunction | Not Available |
|---|
| Application | Not Available |
|---|
| Cellular locations | - Adiposome
- Cell membrane
- Membrane
|
|---|
| Physical Properties |
|---|
| State | Liquid |
|---|
| Experimental Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Predicted Properties | |
|---|
| Spectra |
|---|
| Spectra | |
|---|