| Record Information |
|---|
| Version | 1.0 |
|---|
| Creation Date | 2016-09-30 22:38:24 UTC |
|---|
| Update Date | 2020-05-21 16:27:08 UTC |
|---|
| BMDB ID | BMDB0000905 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Deoxyadenosine monophosphate |
|---|
| Description | Deoxyadenosine monophosphate, also known as deoxyadenylic acid or 2'-dAMP, belongs to the class of organic compounds known as purine 2'-deoxyribonucleoside monophosphates. These are purine nucleotides with monophosphate group linked to the ribose moiety lacking a hydroxyl group at position 2. Deoxyadenosine monophosphate is a strong basic compound (based on its pKa). Deoxyadenosine monophosphate exists in all living species, ranging from bacteria to humans. |
|---|
| Structure | |
|---|
| Synonyms | | Value | Source |
|---|
| 2'-dAMP | ChEBI | | 2'-Deoxy-5'-adenosine monophosphate | ChEBI | | 2'-Deoxy-AMP | ChEBI | | 2'-Deoxyadenosine 5'-(dihydrogen phosphate) | ChEBI | | 2'-Deoxyadenosine 5'-phosphate | ChEBI | | 2'-Deoxyadenosine monophosphate | ChEBI | | 2'-DEOXYADENOSINE-5'-monophosphATE | ChEBI | | 2'-Deoxyadenylic acid | ChEBI | | dAMP | ChEBI | | Deoxy-5'-adenylic acid | ChEBI | | Deoxy-AMP | ChEBI | | Deoxyadenosine 5'-monophosphate | ChEBI | | Deoxyadenosine 5'-phosphate | ChEBI | | Deoxyadenylic acid | ChEBI | | 2'-Deoxyadenosine 5'-monophosphate | Kegg | | 2'-Deoxy-5'-adenosine monophosphoric acid | Generator | | 2'-Deoxyadenosine 5'-(dihydrogen phosphoric acid) | Generator | | 2'-Deoxyadenosine 5'-phosphoric acid | Generator | | 2'-Deoxyadenosine monophosphoric acid | Generator | | 2'-DEOXYADENOSINE-5'-monophosphoric acid | Generator | | 2'-Deoxyadenylate | Generator | | Deoxy-5'-adenylate | Generator | | Deoxyadenosine 5'-monophosphoric acid | Generator | | Deoxyadenosine 5'-phosphoric acid | Generator | | Deoxyadenylate | Generator | | 2'-Deoxyadenosine 5'-monophosphoric acid | Generator | | Deoxyadenosine monophosphoric acid | Generator | | 2'-Deoxy-5'-adenylate | HMDB | | 2'-Deoxy-5'-adenylic acid | HMDB | | 2'-Deoxy-adenosine 5'-phosphorate | HMDB | | 2'-Deoxy-adenosine 5'-phosphoric acid | HMDB | | 2'-Deoxyadenosine-5'-phosphate | HMDB | | Deoxyadenosine-phosphate | HMDB | | PdA | HMDB | | 2'-Deoxy-5'-adenosine monophosphate, ammonium salt | HMDB | | 2'-Deoxy-5'-adenosine monophosphate, disodium salt | HMDB | | 2'Deoxy-5'-AMP | HMDB | | dAMP CPD | HMDB |
|
|---|
| Chemical Formula | C10H14N5O6P |
|---|
| Average Molecular Weight | 331.2218 |
|---|
| Monoisotopic Molecular Weight | 331.068169717 |
|---|
| IUPAC Name | {[(2R,3S,5R)-5-(6-amino-9H-purin-9-yl)-3-hydroxyoxolan-2-yl]methoxy}phosphonic acid |
|---|
| Traditional Name | DAMP |
|---|
| CAS Registry Number | 653-63-4 |
|---|
| SMILES | NC1=NC=NC2=C1N=CN2[C@H]1C[C@H](O)[C@@H](COP(O)(O)=O)O1 |
|---|
| InChI Identifier | InChI=1S/C10H14N5O6P/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5(16)6(21-7)2-20-22(17,18)19/h3-7,16H,1-2H2,(H2,11,12,13)(H2,17,18,19)/t5-,6+,7+/m0/s1 |
|---|
| InChI Key | KHWCHTKSEGGWEX-RRKCRQDMSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | belongs to the class of organic compounds known as purine 2'-deoxyribonucleoside monophosphates. These are purine nucleotides with monophosphate group linked to the ribose moiety lacking a hydroxyl group at position 2. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Nucleosides, nucleotides, and analogues |
|---|
| Class | Purine nucleotides |
|---|
| Sub Class | Purine deoxyribonucleotides |
|---|
| Direct Parent | Purine 2'-deoxyribonucleoside monophosphates |
|---|
| Alternative Parents | |
|---|
| Substituents | - Purine 2'-deoxyribonucleoside monophosphate
- 6-aminopurine
- Imidazopyrimidine
- Purine
- Aminopyrimidine
- Monoalkyl phosphate
- N-substituted imidazole
- Organic phosphoric acid derivative
- Phosphoric acid ester
- Pyrimidine
- Imidolactam
- Alkyl phosphate
- Azole
- Imidazole
- Heteroaromatic compound
- Tetrahydrofuran
- Secondary alcohol
- Azacycle
- Oxacycle
- Organoheterocyclic compound
- Organic oxygen compound
- Primary amine
- Organooxygen compound
- Organonitrogen compound
- Amine
- Organic nitrogen compound
- Organic oxide
- Organopnictogen compound
- Alcohol
- Hydrocarbon derivative
- Aromatic heteropolycyclic compound
|
|---|
| Molecular Framework | Aromatic heteropolycyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Status | Detected but not Quantified |
|---|
| Origin | |
|---|
| Biofunction | Not Available |
|---|
| Application | Not Available |
|---|
| Cellular locations | - Cytoplasm
- Lysosome
- Mitochondria
|
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Properties | | Property | Value | Reference |
|---|
| Melting Point | 148 °C | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Predicted Properties | |
|---|
| Spectra |
|---|
| Spectra | |
|---|