| Record Information |
|---|
| Version | 1.0 |
|---|
| Creation Date | 2016-09-30 22:44:19 UTC |
|---|
| Update Date | 2020-05-21 16:27:05 UTC |
|---|
| BMDB ID | BMDB0001336 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | 3,4-Dihydroxybenzeneacetic acid |
|---|
| Description | 3,4-Dihydroxybenzeneacetic acid, also known as 3,4-dihydroxybenzeneacetic acid or 3,4-dihydroxybenzeneacetic acid, belongs to the class of organic compounds known as catechols. Catechols are compounds containing a 1,2-benzenediol moiety. 3,4-Dihydroxybenzeneacetic acid exists as a solid, possibly soluble (in water), and an extremely weak basic (essentially neutral) compound (based on its pKa) molecule. 3,4-Dihydroxybenzeneacetic acid exists in all living organisms, ranging from bacteria to humans. 3,4-Dihydroxybenzeneacetic acid participates in a number of enzymatic reactions, within cattle. In particular, 3,4-Dihydroxybenzeneacetic acid can be biosynthesized from 3,4-dihydroxyphenylacetaldehyde; which is catalyzed by the enzyme 3,4-dihydroxyphenylacetaldehyde. In addition, 3,4-Dihydroxybenzeneacetic acid and guaiacol can be converted into homovanillic acid and pyrocatechol; which is mediated by the enzyme catechol O-methyltransferase. In cattle, 3,4-dihydroxybenzeneacetic acid is involved in the metabolic pathway called the tyrosine metabolism pathway. |
|---|
| Structure | |
|---|
| Synonyms | | Value | Source |
|---|
| 2-(3,4-DIHYDROXYPHENYL)acetIC ACID | ChEBI | | 3,4-Dihydroxyphenyl acetic acid | ChEBI | | 3,4-Dihydroxyphenylacetic acid | ChEBI | | Dopacetic acid | ChEBI | | Homoprotocatechuate | Kegg | | 2-(3,4-DIHYDROXYPHENYL)acetate | Generator | | 3,4-Dihydroxyphenyl acetate | Generator | | 3,4-Dihydroxyphenylacetate | Generator | | Dopacetate | Generator | | 3,4-Dihydroxybenzeneacetate | Generator | | 3,4 Dihydroxyphenylacetic acid | HMDB | | 3,4-Dihydroxyphenylacetic acid, monosodium salt | HMDB | | (3,4-Dihydroxyphenyl)-acetic acid | HMDB | | (3,4-Dihydroxyphenyl)acetate | HMDB | | (3,4-Dihydroxyphenyl)acetic acid | HMDB | | 3,4-DHPOP | HMDB | | 3,4-Dihydroxy-benzeneacetic acid | HMDB | | 3,4-Dihydroxy-phenylacetic acid | HMDB | | DHY | HMDB | | Dihydroxyphenylacetate | HMDB | | Dihydroxyphenylacetic acid | HMDB | | HAA | HMDB | | Homogentisic acid | HMDB | | 3',4'-Dihydroxyphenylacetic acid | HMDB |
|
|---|
| Chemical Formula | C8H8O4 |
|---|
| Average Molecular Weight | 168.1467 |
|---|
| Monoisotopic Molecular Weight | 168.042258744 |
|---|
| IUPAC Name | 2-(3,4-dihydroxyphenyl)acetic acid |
|---|
| Traditional Name | 3,4 dihydroxyphenylacetic acid |
|---|
| CAS Registry Number | 102-32-9 |
|---|
| SMILES | OC(=O)CC1=CC(O)=C(O)C=C1 |
|---|
| InChI Identifier | InChI=1S/C8H8O4/c9-6-2-1-5(3-7(6)10)4-8(11)12/h1-3,9-10H,4H2,(H,11,12) |
|---|
| InChI Key | CFFZDZCDUFSOFZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | belongs to the class of organic compounds known as catechols. Catechols are compounds containing a 1,2-benzenediol moiety. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Benzenoids |
|---|
| Class | Phenols |
|---|
| Sub Class | Benzenediols |
|---|
| Direct Parent | Catechols |
|---|
| Alternative Parents | |
|---|
| Substituents | - Catechol
- 1-hydroxy-4-unsubstituted benzenoid
- 1-hydroxy-2-unsubstituted benzenoid
- Monocyclic benzene moiety
- Monocarboxylic acid or derivatives
- Carboxylic acid
- Carboxylic acid derivative
- Organic oxygen compound
- Organic oxide
- Hydrocarbon derivative
- Organooxygen compound
- Carbonyl group
- Aromatic homomonocyclic compound
|
|---|
| Molecular Framework | Aromatic homomonocyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Status | Expected but not Quantified |
|---|
| Origin | |
|---|
| Biofunction | Not Available |
|---|
| Application | Not Available |
|---|
| Cellular locations | |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Properties | | Property | Value | Reference |
|---|
| Melting Point | 168 °C | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | 4 mg/mL | Not Available | | LogP | 0.98 | SANGSTER (1994) |
|
|---|
| Predicted Properties | |
|---|
| Spectra |
|---|
| Spectra | |
|---|