| Record Information |
|---|
| Version | 1.0 |
|---|
| Creation Date | 2016-09-30 22:47:07 UTC |
|---|
| Update Date | 2020-05-21 16:28:35 UTC |
|---|
| BMDB ID | BMDB0001520 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Flavin Mononucleotide |
|---|
| Description | Flavin mononucleotide, also known as riboflavin 5'-phosphate or flanin, belongs to the class of organic compounds known as flavin nucleotides. These are nucleotides containing a flavin moiety. Flavin is a compound that contains the tricyclic isoalloxazine ring system, which bears 2 oxo groups at the 2- and 4-positions. Flavin mononucleotide is an extremely weak basic (essentially neutral) compound (based on its pKa). Flavin mononucleotide exists in all living species, ranging from bacteria to humans. |
|---|
| Structure | |
|---|
| Synonyms | | Value | Source |
|---|
| Riboflavin 5'-(dihydrogen phosphate) | ChEBI | | Riboflavin 5'-monophosphate | ChEBI | | Riboflavin 5'-phosphate | ChEBI | | Riboflavin monophosphate | ChEBI | | Riboflavin-5-phosphate | ChEBI | | Riboflavine dihydrogen phosphate | ChEBI | | Riboflavin 5'-(dihydrogen phosphoric acid) | Generator | | Riboflavin 5'-monophosphoric acid | Generator | | Riboflavin 5'-phosphoric acid | Generator | | Riboflavin monophosphoric acid | Generator | | Riboflavin-5-phosphoric acid | Generator | | Riboflavine dihydrogen phosphoric acid | Generator | | Flanin | HMDB | | Flavine mononucleotide | HMDB | | Flavol | HMDB | | FMN | HMDB | | Riboflavin | HMDB | | Riboflavin mononucleotide | HMDB | | Riboflavin phosphate | HMDB | | Riboflavin-5'-phosphate na | HMDB | | Riboflavine 5'-monophosphate | HMDB | | Riboflavine 5'-phosphate | HMDB | | Riboflavine monophosphate | HMDB | | Riboflavine phosphate | HMDB | | Riboflavine-5'-phosphate | HMDB | | Vitamin b2 phosphate | HMDB | | 5'-monoPhosphate, riboflavin | HMDB | | 5'-Phosphate, riboflavin | HMDB | | Flavin mononucleotide sodium salt | HMDB | | Mononucleotide, riboflavin | HMDB | | Flavin mononucleotide monosodium salt | HMDB | | Flavin mononucleotide monosodium salt, dihydrate | HMDB | | Phosphate, sodium riboflavin | HMDB | | Riboflavin 5' phosphate | HMDB | | Riboflavin phosphate, sodium | HMDB | | Mononucleotide, flavin | HMDB | | Riboflavin 5' monophosphate | HMDB | | Flavin mononucleotide disodium salt | HMDB | | Sodium riboflavin phosphate | HMDB |
|
|---|
| Chemical Formula | C17H21N4O9P |
|---|
| Average Molecular Weight | 456.3438 |
|---|
| Monoisotopic Molecular Weight | 456.104614802 |
|---|
| IUPAC Name | {[(2R,3S,4S)-5-{7,8-dimethyl-2,4-dioxo-2H,3H,4H,10H-benzo[g]pteridin-10-yl}-2,3,4-trihydroxypentyl]oxy}phosphonic acid |
|---|
| Traditional Name | riboflavin 5'-phosphate |
|---|
| CAS Registry Number | 146-17-8 |
|---|
| SMILES | CC1=CC2=C(C=C1C)N(C[C@H](O)[C@H](O)[C@H](O)COP(O)(O)=O)C1=NC(=O)NC(=O)C1=N2 |
|---|
| InChI Identifier | InChI=1S/C17H21N4O9P/c1-7-3-9-10(4-8(7)2)21(15-13(18-9)16(25)20-17(26)19-15)5-11(22)14(24)12(23)6-30-31(27,28)29/h3-4,11-12,14,22-24H,5-6H2,1-2H3,(H,20,25,26)(H2,27,28,29)/t11-,12+,14-/m0/s1 |
|---|
| InChI Key | FVTCRASFADXXNN-SCRDCRAPSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | belongs to the class of organic compounds known as flavin nucleotides. These are nucleotides containing a flavin moiety. Flavin is a compound that contains the tricyclic isoalloxazine ring system, which bears 2 oxo groups at the 2- and 4-positions. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Nucleosides, nucleotides, and analogues |
|---|
| Class | Flavin nucleotides |
|---|
| Sub Class | Not Available |
|---|
| Direct Parent | Flavin nucleotides |
|---|
| Alternative Parents | |
|---|
| Substituents | - Flavin nucleotide
- Flavin
- Isoalloxazine
- Diazanaphthalene
- Pteridine
- Quinoxaline
- Monoalkyl phosphate
- Pyrimidone
- Pyrazine
- Organic phosphoric acid derivative
- Phosphoric acid ester
- Benzenoid
- Alkyl phosphate
- Pyrimidine
- Heteroaromatic compound
- Vinylogous amide
- Secondary alcohol
- Lactam
- Azacycle
- Polyol
- Organoheterocyclic compound
- Organooxygen compound
- Organonitrogen compound
- Hydrocarbon derivative
- Organic oxide
- Organopnictogen compound
- Organic oxygen compound
- Alcohol
- Organic nitrogen compound
- Aromatic heteropolycyclic compound
|
|---|
| Molecular Framework | Aromatic heteropolycyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Status | Detected but not Quantified |
|---|
| Origin | |
|---|
| Biofunction | Not Available |
|---|
| Application | Not Available |
|---|
| Cellular locations | |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Properties | | Property | Value | Reference |
|---|
| Melting Point | 290 °C | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | 92 mg/mL | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Predicted Properties | |
|---|
| Spectra |
|---|
| Spectra | |
|---|