| Record Information |
|---|
| Version | 1.0 |
|---|
| Creation Date | 2016-09-30 23:04:58 UTC |
|---|
| Update Date | 2020-05-21 16:29:05 UTC |
|---|
| BMDB ID | BMDB0003502 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Myo-inositol hexakisphosphate |
|---|
| Description | Myo-myo-inositol hexakisphosphate, also known as sodium myo-myo-inositol hexakisphosphate or myo-myo-inositol hexakisphosphate, belongs to the class of organic compounds known as inositol phosphates. Inositol phosphates are compounds containing a phosphate group attached to an inositol (or cyclohexanehexol) moiety. Myo-myo-inositol hexakisphosphate exists as a solid, possibly soluble (in water), and an extremely strong acidic compound (based on its pKa) molecule. Myo-myo-inositol hexakisphosphate exists in all living species, ranging from bacteria to humans. Myo-myo-inositol hexakisphosphate participates in a number of enzymatic reactions, within cattle. In particular, Myo-myo-inositol hexakisphosphate can be biosynthesized from inositol 1,3,4,5,6-pentakisphosphate; which is mediated by the enzyme inositol-pentakisphosphate 2-kinase. In addition, Myo-myo-inositol hexakisphosphate can be biosynthesized from 5-diphosphoinositol pentakisphosphate; which is mediated by the enzyme diphosphoinositol polyphosphate phosphohydrolase 1. In cattle, myo-myo-inositol hexakisphosphate is involved in a couple of metabolic pathways, which include the inositol metabolism pathway and the inositol phosphate metabolism pathway. |
|---|
| Structure | |
|---|
| Synonyms | | Value | Source |
|---|
| 1D-Myo-inositol 1,2,3,4,5,6-hexakisphosphate | ChEBI | | 1D-Myo-inositol hexakisphosphate | ChEBI | | Acide fytique | ChEBI | | Acido fitico | ChEBI | | Acidum fyticum | ChEBI | | D-Myo-inositol 1,2,3,4,5,6-hexakisphosphate | ChEBI | | Inosithexaphosphorsaeure | ChEBI | | Myo-inositol 1,2,3,4,5,6-hexakisphosphate | ChEBI | | Phytate | ChEBI | | Phytic acid | ChEBI | | Phytine | ChEBI | | Saeure des phytins | ChEBI | | Inositol 1,2,3,4,5,6-hexakisphosphate | Kegg | | 1D-Myo-inositol 1,2,3,4,5,6-hexakisphosphoric acid | Generator | | 1D-Myo-inositol hexakisphosphoric acid | Generator | | D-Myo-inositol 1,2,3,4,5,6-hexakisphosphoric acid | Generator | | Myo-inositol 1,2,3,4,5,6-hexakisphosphoric acid | Generator | | Inositol 1,2,3,4,5,6-hexakisphosphoric acid | Generator | | Myo-inositol hexakisphosphoric acid | Generator | | Inositol hexakis(phosphate) | HMDB | | Inositol hexaphosphate | HMDB | | Meso-inositol hexaphosphate | HMDB | | Myo-inositol hexakis(phosphate) | HMDB | | Myo-inositol hexaphosphate | HMDB | | IP6 | HMDB | | InsP6 | HMDB | | myo-Inositol hexakisphosphate | HMDB |
|
|---|
| Chemical Formula | C6H18O24P6 |
|---|
| Average Molecular Weight | 660.0353 |
|---|
| Monoisotopic Molecular Weight | 659.861370576 |
|---|
| IUPAC Name | {[(1s,2R,3R,4r,5S,6S)-2,3,4,5,6-pentakis(phosphonooxy)cyclohexyl]oxy}phosphonic acid |
|---|
| Traditional Name | [(1s,2R,3R,4r,5S,6S)-2,3,4,5,6-pentakis(phosphonooxy)cyclohexyl]oxyphosphonic acid |
|---|
| CAS Registry Number | 83-86-3 |
|---|
| SMILES | OP(O)(=O)O[C@H]1[C@H](OP(O)(O)=O)[C@@H](OP(O)(O)=O)[C@H](OP(O)(O)=O)[C@H](OP(O)(O)=O)[C@@H]1OP(O)(O)=O |
|---|
| InChI Identifier | InChI=1S/C6H18O24P6/c7-31(8,9)25-1-2(26-32(10,11)12)4(28-34(16,17)18)6(30-36(22,23)24)5(29-35(19,20)21)3(1)27-33(13,14)15/h1-6H,(H2,7,8,9)(H2,10,11,12)(H2,13,14,15)(H2,16,17,18)(H2,19,20,21)(H2,22,23,24)/t1-,2-,3-,4+,5-,6- |
|---|
| InChI Key | IMQLKJBTEOYOSI-GPIVLXJGSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | belongs to the class of organic compounds known as inositol phosphates. Inositol phosphates are compounds containing a phosphate group attached to an inositol (or cyclohexanehexol) moiety. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Organic oxygen compounds |
|---|
| Class | Organooxygen compounds |
|---|
| Sub Class | Alcohols and polyols |
|---|
| Direct Parent | Inositol phosphates |
|---|
| Alternative Parents | |
|---|
| Substituents | - Inositol phosphate
- Monoalkyl phosphate
- Alkyl phosphate
- Phosphoric acid ester
- Organic phosphoric acid derivative
- Organic oxide
- Hydrocarbon derivative
- Aliphatic homomonocyclic compound
|
|---|
| Molecular Framework | Aliphatic homomonocyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Status | Expected but not Quantified |
|---|
| Origin | |
|---|
| Biofunction | Not Available |
|---|
| Application | Not Available |
|---|
| Cellular locations | |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Properties | | Property | Value | Reference |
|---|
| Melting Point | < 25 °C | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | 1000 mg/mL | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Predicted Properties | |
|---|
| Spectra |
|---|
| Spectra | |
|---|