| Record Information |
|---|
| Version | 1.0 |
|---|
| Creation Date | 2016-09-30 22:19:00 UTC |
|---|
| Update Date | 2020-05-20 23:09:27 UTC |
|---|
| BMDB ID | BMDB0000052 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Argininosuccinic acid |
|---|
| Description | Argininosuccinic acid, also known as L-argininosuccinate or ASA, belongs to the class of organic compounds known as aspartic acid and derivatives. Aspartic acid and derivatives are compounds containing an aspartic acid or a derivative thereof resulting from reaction of aspartic acid at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. Argininosuccinic acid is a very strong basic compound (based on its pKa). Argininosuccinic acid exists in all living species, ranging from bacteria to humans. Argininosuccinic acid is a potentially toxic compound. Argininosuccinic acid, with regard to humans, has been found to be associated with the diseases such as argininosuccinyl-coa lyase deficiency; argininosuccinic acid has also been linked to several inborn metabolic disorders including argininemia and argininosuccinic aciduria. |
|---|
| Structure | |
|---|
| Synonyms | | Value | Source |
|---|
| 2-(Nomega-L-arginino)succinate | Kegg | | L-Argininosuccinate | Kegg | | L-Argininosuccinic acid | Kegg | | L-Arginosuccinic acid | Kegg | | 2-(Nomega-L-arginino)succinic acid | Generator | | L-Arginosuccinate | Generator | | Argininosuccinate | Generator | | 2-(N(Omega)-L-arginine)succinate | HMDB | | 2-(N(Omega)-L-arginine)succinic acid | HMDB | | 2-(N(Omega)-L-arginino)succinate | HMDB | | 2-(N(Omega)-L-arginino)succinic acid | HMDB | | 2-(Nw-l-arginino)butanedioate | HMDB | | 2-(Nw-l-arginino)butanedioic acid | HMDB | | Arginosuccinate | HMDB | | Arginosuccinic acid | HMDB | | ASA | HMDB | | N(Omega)-(L-arginino)succinate | HMDB | | N(Omega)-(L-arginino)succinic acid | HMDB | | N-(((4-Amino-4-carboxybutyl)amino)iminomethyl)-L-aspartate | HMDB | | N-(((4-Amino-4-carboxybutyl)amino)iminomethyl)-L-aspartic acid | HMDB | | N-(L-Arginino) succinate | HMDB | | N-(L-Arginino) succinic acid | HMDB | | N-(L-Arginino)succinate | HMDB | | N-(L-Arginino)succinic acid | HMDB | | N-[(4-Amino-4-carboxybutyl)amidino]-L-aspartate | HMDB | | N-[(4-Amino-4-carboxybutyl)amidino]-L-aspartic acid | HMDB | | N-[[(4-Amino-4-carboxybutyl)amino]iminomethyl]-L-aspartate | HMDB | | N-[[(4-Amino-4-carboxybutyl)amino]iminomethyl]-L-aspartic acid | HMDB | | Acid, argininosuccinic | HMDB | | N-(4-Amino-4-carboxybutyl)amidino-L-aspartic acid | HMDB |
|
|---|
| Chemical Formula | C10H18N4O6 |
|---|
| Average Molecular Weight | 290.2731 |
|---|
| Monoisotopic Molecular Weight | 290.122634328 |
|---|
| IUPAC Name | (2S)-2-{N'-[(4S)-4-amino-4-carboxybutyl]carbamimidamido}butanedioic acid |
|---|
| Traditional Name | argininosuccinic acid |
|---|
| CAS Registry Number | 2387-71-5 |
|---|
| SMILES | N[C@@H](CCCNC(=N)N[C@@H](CC(O)=O)C(O)=O)C(O)=O |
|---|
| InChI Identifier | InChI=1S/C10H18N4O6/c11-5(8(17)18)2-1-3-13-10(12)14-6(9(19)20)4-7(15)16/h5-6H,1-4,11H2,(H,15,16)(H,17,18)(H,19,20)(H3,12,13,14)/t5-,6-/m0/s1 |
|---|
| InChI Key | KDZOASGQNOPSCU-WDSKDSINSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | belongs to the class of organic compounds known as aspartic acid and derivatives. Aspartic acid and derivatives are compounds containing an aspartic acid or a derivative thereof resulting from reaction of aspartic acid at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Organic acids and derivatives |
|---|
| Class | Carboxylic acids and derivatives |
|---|
| Sub Class | Amino acids, peptides, and analogues |
|---|
| Direct Parent | Aspartic acid and derivatives |
|---|
| Alternative Parents | |
|---|
| Substituents | - Aspartic acid or derivatives
- Alpha-amino acid
- L-alpha-amino acid
- Tricarboxylic acid or derivatives
- Guanidine
- Amino acid
- Organic 1,3-dipolar compound
- Propargyl-type 1,3-dipolar organic compound
- Carboximidamide
- Carboxylic acid
- Hydrocarbon derivative
- Organopnictogen compound
- Organic oxygen compound
- Primary amine
- Organooxygen compound
- Organonitrogen compound
- Primary aliphatic amine
- Carbonyl group
- Amine
- Organic nitrogen compound
- Organic oxide
- Aliphatic acyclic compound
|
|---|
| Molecular Framework | Aliphatic acyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Status | Expected but not Quantified |
|---|
| Origin | |
|---|
| Biofunction | Not Available |
|---|
| Application | Not Available |
|---|
| Cellular locations | |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Predicted Properties | |
|---|
| Spectra |
|---|
| Spectra | |
|---|