| Record Information |
|---|
| Version | 1.0 |
|---|
| Creation Date | 2016-09-30 22:36:58 UTC |
|---|
| Update Date | 2020-05-21 16:26:52 UTC |
|---|
| BMDB ID | BMDB0000812 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | N-Acetyl-L-aspartic acid |
|---|
| Description | N-Acetyl-L-aspartic acid, also known as acetylaspartate or NAA, belongs to the class of organic compounds known as aspartic acid and derivatives. Aspartic acid and derivatives are compounds containing an aspartic acid or a derivative thereof resulting from reaction of aspartic acid at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. N-Acetyl-L-aspartic acid is an extremely weak basic (essentially neutral) compound (based on its pKa). N-Acetyl-L-aspartic acid exists in all living organisms, ranging from bacteria to humans. N-acetyl-L-aspartic acid can be converted into acetic acid and L-aspartic acid; which is mediated by the enzyme aspartoacylase. In cattle, N-acetyl-L-aspartic acid is involved in the metabolic pathway called the aspartate metabolism pathway. N-Acetyl-L-aspartic acid is a potentially toxic compound. |
|---|
| Structure | |
|---|
| Synonyms | | Value | Source |
|---|
| (S)-2-(Acetylamino)butanedioic acid | ChEBI | | (S)-2-(Acetylamino)succinic acid | ChEBI | | Acetyl-L-aspartic acid | ChEBI | | Acetylaspartic acid | ChEBI | | L-N-Acetylaspartic acid | ChEBI | | N-Acetylaspartic acid | ChEBI | | NAA | ChEBI | | (S)-2-(Acetylamino)butanedioate | Generator | | (S)-2-(Acetylamino)succinate | Generator | | Acetyl-L-aspartate | Generator | | Acetylaspartate | Generator | | L-N-Acetylaspartate | Generator | | N-Acetylaspartate | Generator | | N-Acetyl-L-aspartate | Generator | | (2S)-2-Acetamidobutanedioate | HMDB | | (2S)-2-Acetamidobutanedioic acid | HMDB | | N-Acetyl-S-aspartate | HMDB | | N-Acetyl-S-aspartic acid | HMDB | | N-Acetyl aspartate | HMDB | | N-Acetylaspartate, monopotassium salt | HMDB | | Acetyl aspartic acid | HMDB |
|
|---|
| Chemical Formula | C6H9NO5 |
|---|
| Average Molecular Weight | 175.1394 |
|---|
| Monoisotopic Molecular Weight | 175.048072403 |
|---|
| IUPAC Name | (2S)-2-acetamidobutanedioic acid |
|---|
| Traditional Name | acetyl-L-aspartic acid |
|---|
| CAS Registry Number | 997-55-7 |
|---|
| SMILES | CC(=O)N[C@@H](CC(O)=O)C(O)=O |
|---|
| InChI Identifier | InChI=1S/C6H9NO5/c1-3(8)7-4(6(11)12)2-5(9)10/h4H,2H2,1H3,(H,7,8)(H,9,10)(H,11,12)/t4-/m0/s1 |
|---|
| InChI Key | OTCCIMWXFLJLIA-BYPYZUCNSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | belongs to the class of organic compounds known as aspartic acid and derivatives. Aspartic acid and derivatives are compounds containing an aspartic acid or a derivative thereof resulting from reaction of aspartic acid at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Organic acids and derivatives |
|---|
| Class | Carboxylic acids and derivatives |
|---|
| Sub Class | Amino acids, peptides, and analogues |
|---|
| Direct Parent | Aspartic acid and derivatives |
|---|
| Alternative Parents | |
|---|
| Substituents | - Aspartic acid or derivatives
- N-acyl-alpha-amino acid
- N-acyl-alpha amino acid or derivatives
- N-acyl-l-alpha-amino acid
- Dicarboxylic acid or derivatives
- Fatty acid
- Acetamide
- Carboxamide group
- Secondary carboxylic acid amide
- Carboxylic acid
- Carbonyl group
- Organooxygen compound
- Organonitrogen compound
- Organopnictogen compound
- Organic oxygen compound
- Organic nitrogen compound
- Organic oxide
- Hydrocarbon derivative
- Aliphatic acyclic compound
|
|---|
| Molecular Framework | Aliphatic acyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Status | Expected but not Quantified |
|---|
| Origin | |
|---|
| Biofunction | Not Available |
|---|
| Application | Not Available |
|---|
| Cellular locations | - Cytoplasm
- Mitochondria
- Myelin sheath
|
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Properties | | Property | Value | Reference |
|---|
| Melting Point | 137 - 140 °C | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | 675 mg/mL | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Predicted Properties | |
|---|
| Spectra |
|---|
| Spectra | |
|---|