| Record Information |
|---|
| Version | 1.0 |
|---|
| Creation Date | 2016-09-30 22:39:12 UTC |
|---|
| Update Date | 2020-05-21 16:28:57 UTC |
|---|
| BMDB ID | BMDB0000961 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Farnesyl pyrophosphate |
|---|
| Description | Farnesyl pyrophosphate, also known as farnesyl pyrophosphate or farnesyl-PP, belongs to the class of organic compounds known as sesquiterpenoids. These are terpenes with three consecutive isoprene units. Farnesyl pyrophosphate is a very hydrophobic molecule, practically insoluble (in water), and relatively neutral. Farnesyl pyrophosphate exists in all living species, ranging from bacteria to humans. In cattle, farnesyl pyrophosphate is involved in the metabolic pathway called the porphyrin metabolism pathway. |
|---|
| Structure | |
|---|
| Synonyms | | Value | Source |
|---|
| (2E,6E)-Farnesol diphosphate | ChEBI | | (2E,6E)-Farnesyl diphosphate | ChEBI | | (2E,6E)-Farnesyl pyrophosphate | ChEBI | | (all-e)-Farnesyl diphosphate | ChEBI | | (e,e)-Farnesyl pyrophosphate | ChEBI | | 2-trans,6-trans-Farnesyl pyrophosphate | ChEBI | | all-trans-Farnesyl pyrophosphate | ChEBI | | Farnesyl diphosphate | ChEBI | | trans,trans-Farnesyl diphosphate | ChEBI | | trans-trans-Farnesyl diphosphate | ChEBI | | 2-trans,6-trans-Farnesyl diphosphate | Kegg | | (2E,6E)-Farnesol diphosphoric acid | Generator | | (2E,6E)-Farnesyl diphosphoric acid | Generator | | (2E,6E)-Farnesyl pyrophosphoric acid | Generator | | (all-e)-Farnesyl diphosphoric acid | Generator | | (e,e)-Farnesyl pyrophosphoric acid | Generator | | 2-trans,6-trans-Farnesyl pyrophosphoric acid | Generator | | all-trans-Farnesyl pyrophosphoric acid | Generator | | Farnesyl diphosphoric acid | Generator | | trans,trans-Farnesyl diphosphoric acid | Generator | | trans-trans-Farnesyl diphosphoric acid | Generator | | 2-trans,6-trans-Farnesyl diphosphoric acid | Generator | | Farnesyl pyrophosphoric acid | Generator | | (e,e)-Farnesyl diphosphate | HMDB | | Farnesyl-PP | HMDB | | trans-Farnesyl pyrophosphate | HMDB | | trans-trans-Farnesyl pyrophosphate | HMDB | | Farnesyl pyrophosphate, (e,e)-isomer | HMDB | | Farnesyl pyrophosphate, (e,Z)-isomer | HMDB | | Farnesyl pyrophosphate, (Z,e)-isomer | HMDB | | Farnesyl pyrophosphate, (Z,Z)-isomer | HMDB | | Farnesylpyrophosphate | HMDB |
|
|---|
| Chemical Formula | C15H28O7P2 |
|---|
| Average Molecular Weight | 382.33 |
|---|
| Monoisotopic Molecular Weight | 382.131027238 |
|---|
| IUPAC Name | {[hydroxy({[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]oxy})phosphoryl]oxy}phosphonic acid |
|---|
| Traditional Name | farnesyl diphosphate |
|---|
| CAS Registry Number | 13058-04-3 |
|---|
| SMILES | [H]OP(=O)(O[H])OP(=O)(O[H])OC\C=C(/C)CC\C=C(/C)CCC=C(C)C |
|---|
| InChI Identifier | InChI=1S/C15H28O7P2/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-12-21-24(19,20)22-23(16,17)18/h7,9,11H,5-6,8,10,12H2,1-4H3,(H,19,20)(H2,16,17,18)/b14-9+,15-11+ |
|---|
| InChI Key | VWFJDQUYCIWHTN-YFVJMOTDSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | belongs to the class of organic compounds known as sesquiterpenoids. These are terpenes with three consecutive isoprene units. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Lipids and lipid-like molecules |
|---|
| Class | Prenol lipids |
|---|
| Sub Class | Sesquiterpenoids |
|---|
| Direct Parent | Sesquiterpenoids |
|---|
| Alternative Parents | |
|---|
| Substituents | - Farsesane sesquiterpenoid
- Sesquiterpenoid
- Organic pyrophosphate
- Isoprenoid phosphate
- Monoalkyl phosphate
- Alkyl phosphate
- Phosphoric acid ester
- Organic phosphoric acid derivative
- Organic oxygen compound
- Organic oxide
- Hydrocarbon derivative
- Organooxygen compound
- Aliphatic acyclic compound
|
|---|
| Molecular Framework | Aliphatic acyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Status | Expected but not Quantified |
|---|
| Origin | |
|---|
| Biofunction | Not Available |
|---|
| Application | Not Available |
|---|
| Cellular locations | - Cell membrane
- Cytoplasm
- Endoplasmic reticulum
- Membrane
- Mitochondria
- Peroxisome
|
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Predicted Properties | |
|---|
| Spectra |
|---|
| Spectra | |
|---|