| Record Information |
|---|
| Version | 1.0 |
|---|
| Creation Date | 2016-09-30 22:39:13 UTC |
|---|
| Update Date | 2020-05-21 16:28:44 UTC |
|---|
| BMDB ID | BMDB0000962 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Lipoamide |
|---|
| Description | Lipoamidee, also known as lipoamidee or lipoamidee, belongs to the class of organic compounds known as lipoamidees. Lipoamidees are compounds containing a lipoamidee moiety, which consists of a pentanamide attached to the C3 carbon atom of a 1,2-dithiolane ring. Thus, lipoamidee is considered to be a fatty amide lipid molecule. Lipoamidee exists as a solid, very hydrophobic, practically insoluble (in water), and relatively neutral molecule. Lipoamidee exists in all living species, ranging from bacteria to humans. In cattle, lipoamidee is involved in the metabolic pathway called the citric Acid cycle pathway. |
|---|
| Structure | |
|---|
| Synonyms | | Value | Source |
|---|
| 1,2-Dithiolane-3-pentanamide | ChEBI | | alpha-Lipoic acid amide | ChEBI | | Lipoacin | ChEBI | | Thioctamide | ChEBI | | Thioctic acid amide | ChEBI | | Vitamin N | ChEBI | | a-Lipoate amide | Generator | | a-Lipoic acid amide | Generator | | alpha-Lipoate amide | Generator | | Α-lipoate amide | Generator | | Α-lipoic acid amide | Generator | | Thioctate amide | Generator | | 5-(1,2-Dithiolan-3-yl)-pentanamide | HMDB | | 5-(1,2-Dithiolan-3-yl)pentanamide | HMDB | | 5-(1,2-Dithiolan-3-yl)valeramide | HMDB | | 5-(Dithiolan-3-yl)valeramide | HMDB | | alpha-Lipoate | HMDB | | alpha-Lipoic acid | HMDB | | DL-6-Thioctic amide | HMDB | | DL-Lipoamide | HMDB | | Lipamide | HMDB | | Lipoamid | HMDB | | Lipoicin | HMDB | | Lipozyme | HMDB | | Lypoaran | HMDB | | Pathoclon | HMDB | | Thioami | HMDB | | Thioctamid | HMDB | | Thiotomin | HMDB | | Ticolin | HMDB | | 1,2-Dithiolane-3-valeramide | HMDB | | 6,8-Thioctic amide | HMDB | | alpha-Lipoic amide | HMDB | | Lipoamide, (+-)-isomer | HMDB |
|
|---|
| Chemical Formula | C8H15NOS2 |
|---|
| Average Molecular Weight | 205.341 |
|---|
| Monoisotopic Molecular Weight | 205.059505487 |
|---|
| IUPAC Name | 5-(1,2-dithiolan-3-yl)pentanamide |
|---|
| Traditional Name | lipoamide |
|---|
| CAS Registry Number | 940-69-2 |
|---|
| SMILES | NC(=O)CCCCC1CCSS1 |
|---|
| InChI Identifier | InChI=1S/C8H15NOS2/c9-8(10)4-2-1-3-7-5-6-11-12-7/h7H,1-6H2,(H2,9,10) |
|---|
| InChI Key | FCCDDURTIIUXBY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | belongs to the class of organic compounds known as lipoamides. Lipoamides are compounds containing a lipoamide moiety, which consists of a pentanamide attached to the C3 carbon atom of a 1,2-dithiolane ring. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Organoheterocyclic compounds |
|---|
| Class | Dithiolanes |
|---|
| Sub Class | Lipoamides |
|---|
| Direct Parent | Lipoamides |
|---|
| Alternative Parents | |
|---|
| Substituents | - Lipoamide
- Fatty amide
- Fatty acyl
- 1,2-dithiolane
- Carboxamide group
- Organic disulfide
- Primary carboxylic acid amide
- Carboxylic acid derivative
- Carbonyl group
- Organooxygen compound
- Organonitrogen compound
- Hydrocarbon derivative
- Organic oxide
- Organopnictogen compound
- Organic oxygen compound
- Organic nitrogen compound
- Aliphatic heteromonocyclic compound
|
|---|
| Molecular Framework | Aliphatic heteromonocyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Status | Expected but not Quantified |
|---|
| Origin | |
|---|
| Biofunction | Not Available |
|---|
| Application | Not Available |
|---|
| Cellular locations | - Cell membrane
- Membrane
- Mitochondria
|
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Properties | | Property | Value | Reference |
|---|
| Melting Point | 126.0 - 129.0 °C | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Predicted Properties | |
|---|
| Spectra |
|---|
| Spectra | |
|---|
