| Record Information |
|---|
| Version | 1.0 |
|---|
| Creation Date | 2016-09-30 22:40:18 UTC |
|---|
| Update Date | 2020-05-21 16:28:52 UTC |
|---|
| BMDB ID | BMDB0001044 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | 2'-Deoxyguanosine 5'-monophosphate |
|---|
| Description | 2'-Deoxyguanosine 5'-monophosphate, also known as deoxyguanylic acid or 2'-deoxy-GMP, belongs to the class of organic compounds known as purine 2'-deoxyribonucleoside monophosphates. These are purine nucleotides with monophosphate group linked to the ribose moiety lacking a hydroxyl group at position 2. 2'-Deoxyguanosine 5'-monophosphate is a moderately basic compound (based on its pKa). 2'-Deoxyguanosine 5'-monophosphate exists in all living species, ranging from bacteria to humans. |
|---|
| Structure | |
|---|
| Synonyms | | Value | Source |
|---|
| 2'-Deoxy-GMP | ChEBI | | 2'-Deoxyguanosine 5'-(dihydrogen phosphate) | ChEBI | | 2'-Deoxyguanosine 5'-phosphate | ChEBI | | 2'-Deoxyguanylic acid | ChEBI | | 2'-dGMP | ChEBI | | Deoxy-GMP | ChEBI | | Deoxyguanosine 5'-monophosphate | ChEBI | | Deoxyguanosine 5'-phosphate | ChEBI | | Deoxyguanosine monophosphate | ChEBI | | Deoxyguanylic acid | ChEBI | | dGMP | ChEBI | | 2'-Deoxyguanosine 5'-(dihydrogen phosphoric acid) | Generator | | 2'-Deoxyguanosine 5'-phosphoric acid | Generator | | 2'-Deoxyguanylate | Generator | | Deoxyguanosine 5'-monophosphoric acid | Generator | | Deoxyguanosine 5'-phosphoric acid | Generator | | Deoxyguanosine monophosphoric acid | Generator | | Deoxyguanylate | Generator | | 2'-Deoxyguanosine 5'-monophosphoric acid | Generator | | 2'-Deoxy-5'-GMP | HMDB | | 2'-Deoxy-5'-guanylate | HMDB | | 2'-Deoxy-5'-guanylic acid | HMDB | | 2'-Deoxy-guanosine 5'-(dihydrogen phosphate) | HMDB | | 2'-Deoxy-guanosine 5'-phosphate | HMDB | | 2'-Deoxy-guanosine phosphate | HMDB | | 2'-Deoxyguanosine-5'-phosphate | HMDB | | 2'-DG-5'-MP | HMDB | | Deoxyguanosine-phosphate | HMDB | | Guanine riboside | HMDB | | 2'-Deoxyguanosine 5'-phosphate, ion (1+) | HMDB | | 2'-Deoxyguanosine 5'-phosphate, disodium salt | HMDB |
|
|---|
| Chemical Formula | C10H14N5O7P |
|---|
| Average Molecular Weight | 347.2212 |
|---|
| Monoisotopic Molecular Weight | 347.063084339 |
|---|
| IUPAC Name | {[(2R,3S,5R)-5-(2-amino-6-oxo-6,9-dihydro-3H-purin-9-yl)-3-hydroxyoxolan-2-yl]methoxy}phosphonic acid |
|---|
| Traditional Name | deoxyguanylate |
|---|
| CAS Registry Number | 902-04-5 |
|---|
| SMILES | NC1=NC2=C(N=CN2[C@H]2C[C@H](O)[C@@H](COP(O)(O)=O)O2)C(=O)N1 |
|---|
| InChI Identifier | InChI=1S/C10H14N5O7P/c11-10-13-8-7(9(17)14-10)12-3-15(8)6-1-4(16)5(22-6)2-21-23(18,19)20/h3-6,16H,1-2H2,(H2,18,19,20)(H3,11,13,14,17)/t4-,5+,6+/m0/s1 |
|---|
| InChI Key | LTFMZDNNPPEQNG-KVQBGUIXSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | belongs to the class of organic compounds known as purine 2'-deoxyribonucleoside monophosphates. These are purine nucleotides with monophosphate group linked to the ribose moiety lacking a hydroxyl group at position 2. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Nucleosides, nucleotides, and analogues |
|---|
| Class | Purine nucleotides |
|---|
| Sub Class | Purine deoxyribonucleotides |
|---|
| Direct Parent | Purine 2'-deoxyribonucleoside monophosphates |
|---|
| Alternative Parents | |
|---|
| Substituents | - Purine 2'-deoxyribonucleoside monophosphate
- Imidazopyrimidine
- Purine
- Hydroxypyrimidine
- Monoalkyl phosphate
- N-substituted imidazole
- Organic phosphoric acid derivative
- Phosphoric acid ester
- Alkyl phosphate
- Pyrimidine
- Azole
- Imidazole
- Heteroaromatic compound
- Tetrahydrofuran
- Secondary alcohol
- Organoheterocyclic compound
- Azacycle
- Oxacycle
- Organooxygen compound
- Organonitrogen compound
- Hydrocarbon derivative
- Organic oxide
- Organopnictogen compound
- Organic oxygen compound
- Organic nitrogen compound
- Alcohol
- Aromatic heteropolycyclic compound
|
|---|
| Molecular Framework | Aromatic heteropolycyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Status | Expected but not Quantified |
|---|
| Origin | |
|---|
| Biofunction | Not Available |
|---|
| Application | Not Available |
|---|
| Cellular locations | - Cytoplasm
- Lysosome
- Mitochondria
|
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Predicted Properties | |
|---|
| Spectra |
|---|
| Spectra | |
|---|