| Record Information |
|---|
| Version | 1.0 |
|---|
| Creation Date | 2016-09-30 22:43:04 UTC |
|---|
| Update Date | 2020-05-21 16:28:43 UTC |
|---|
| BMDB ID | BMDB0001251 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Lanosterin |
|---|
| Description | Lanosterin, also known as botalan base 138 or lanosterol, belongs to the class of organic compounds known as triterpenoids. These are terpene molecules containing six isoprene units. Thus, lanosterin is considered to be a sterol lipid molecule. Lanosterin is a very hydrophobic molecule, practically insoluble (in water), and relatively neutral. |
|---|
| Structure | |
|---|
| Synonyms | | Value | Source |
|---|
| (3beta)-Lanosta-8,24-dien-3-ol | ChEBI | | (3beta,5alpha)-4,4,14-Trimethylcholesta-8,24-dien-3-ol | ChEBI | | 4,4',14alpha-Trimethyl-5alpha-cholesta-8,24-dien-3beta-ol | ChEBI | | (3b)-Lanosta-8,24-dien-3-ol | Generator | | (3β)-Lanosta-8,24-dien-3-ol | Generator | | (3b,5a)-4,4,14-Trimethylcholesta-8,24-dien-3-ol | Generator | | (3β,5α)-4,4,14-Trimethylcholesta-8,24-dien-3-ol | Generator | | 4,4',14a-Trimethyl-5a-cholesta-8,24-dien-3b-ol | Generator | | 4,4',14α-Trimethyl-5α-cholesta-8,24-dien-3β-ol | Generator | | (3 beta)-Lanosta-8,24-dien-3-ol | HMDB | | (3alpha)-4,4,14-Trimethyl-cholesta-8,24-dien-3-ol | HMDB | | (3beta,5alpha)-4,4,14-Trimethyl-cholesta-8,24-dien-3-ol | HMDB | | Botalan base 138 | HMDB | | Lanosta-8,24-dien-3-ol | HMDB | | Lanosta-8,24-dien-3beta-ol | HMDB | | Lanosta-8,24-dienol | HMDB | | Lanosterol | HMDB | | Lanster | HMDB | | 4,4,14 alpha-Trimethyl-5 alpha-cholesta-8,24-dien-3 beta-ol | MeSH, HMDB | | Kryptosterol | MeSH, HMDB | | Lanosterin | ChEBI | | 3beta-Hydroxy-lansota-8,24-dien-21-oic acid | HMDB | | 3beta-Hydroxylanosta-8,24-diene | HMDB | | 3β-Hydroxy-lansota-8,24-dien-21-oic acid | HMDB | | 3β-Hydroxylanosta-8,24-diene | HMDB | | 4,4,14alpha-Trimethylcholesta-8,24-dien-3beta-ol | HMDB | | 4,4,14α-Trimethylcholesta-8,24-dien-3β-ol | HMDB | | 5alpha-Lanosta-8,24-dien-3beta-ol | HMDB | | 5α-Lanosta-8,24-dien-3β-ol | HMDB | | Lanosta-8,24-dien-3β-ol | HMDB | | Lanostadien-3beta-ol | HMDB | | Lanostadien-3β-ol | HMDB |
|
|---|
| Chemical Formula | C30H50O |
|---|
| Average Molecular Weight | 426.7174 |
|---|
| Monoisotopic Molecular Weight | 426.386166222 |
|---|
| IUPAC Name | (2S,5S,7R,11R,14R,15R)-2,6,6,11,15-pentamethyl-14-[(2R)-6-methylhept-5-en-2-yl]tetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadec-1(10)-en-5-ol |
|---|
| Traditional Name | (2S,5S,7R,11R,14R,15R)-2,6,6,11,15-pentamethyl-14-[(2R)-6-methylhept-5-en-2-yl]tetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadec-1(10)-en-5-ol |
|---|
| CAS Registry Number | 79-63-0 |
|---|
| SMILES | [H][C@@]1(CC[C@@]2(C)C3=C(CC[C@]12C)[C@@]1(C)CC[C@H](O)C(C)(C)[C@]1([H])CC3)[C@H](C)CCC=C(C)C |
|---|
| InChI Identifier | InChI=1S/C30H50O/c1-20(2)10-9-11-21(3)22-14-18-30(8)24-12-13-25-27(4,5)26(31)16-17-28(25,6)23(24)15-19-29(22,30)7/h10,21-22,25-26,31H,9,11-19H2,1-8H3/t21-,22-,25+,26+,28-,29-,30+/m1/s1 |
|---|
| InChI Key | CAHGCLMLTWQZNJ-BQNIITSRSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | belongs to the class of organic compounds known as triterpenoids. These are terpene molecules containing six isoprene units. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Lipids and lipid-like molecules |
|---|
| Class | Prenol lipids |
|---|
| Sub Class | Triterpenoids |
|---|
| Direct Parent | Triterpenoids |
|---|
| Alternative Parents | |
|---|
| Substituents | - Triterpenoid
- 14-alpha-methylsteroid
- 3-beta-hydroxysteroid
- Hydroxysteroid
- 3-hydroxysteroid
- Steroid
- Cyclic alcohol
- Secondary alcohol
- Organic oxygen compound
- Hydrocarbon derivative
- Organooxygen compound
- Alcohol
- Aliphatic homopolycyclic compound
|
|---|
| Molecular Framework | Aliphatic homopolycyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Status | Expected but not Quantified |
|---|
| Origin | |
|---|
| Biofunction | Not Available |
|---|
| Application | Not Available |
|---|
| Cellular locations | - Cell membrane
- Cytoplasm
- Endoplasmic reticulum
- Membrane
|
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Properties | | Property | Value | Reference |
|---|
| Melting Point | 140.5 °C | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Predicted Properties | |
|---|
| Spectra |
|---|
| Spectra | |
|---|