| Record Information |
|---|
| Version | 1.0 |
|---|
| Creation Date | 2016-09-30 22:20:00 UTC |
|---|
| Update Date | 2020-06-04 20:45:00 UTC |
|---|
| BMDB ID | BMDB0000133 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Guanosine |
|---|
| Description | Guanosine, also known as G or 2-amino-inosine, belongs to the class of organic compounds known as purine nucleosides. Purine nucleosides are compounds comprising a purine base attached to a ribosyl or deoxyribosyl moiety. Guanosine exists as a solid, possibly soluble (in water), and a moderately basic compound (based on its pKa) molecule. Guanosine exists in all living species, ranging from bacteria to humans. In cattle, guanosine is involved in a couple of metabolic pathways, which include the intracellular signalling through adenosine receptor A2A and adenosine pathway and the intracellular signalling through adenosine receptor A2B and adenosine pathway. Guanosine is a potentially toxic compound. |
|---|
| Structure | |
|---|
| Synonyms | | Value | Source |
|---|
| 2(3H)-Imino-9-beta-D-ribofuranosyl-9H-purin-6(1H)-one | ChEBI | | 2-Amino-1,9-dihydro-9-beta-D-ribofuranosyl-6H-purin-6-one | ChEBI | | 2-Amino-9-beta-D-ribofuranosyl-1,9-dihydro-6H-purin-6-one | ChEBI | | 9-beta-D-Ribofuranosyl-guanine | ChEBI | | G | ChEBI | | Guanine riboside | ChEBI | | Guanine-9-beta-D-ribofuranoside | ChEBI | | Guanosin | ChEBI | | Guo | ChEBI | | 2(3H)-Imino-9-b-D-ribofuranosyl-9H-purin-6(1H)-one | Generator | | 2(3H)-Imino-9-β-D-ribofuranosyl-9H-purin-6(1H)-one | Generator | | 2-Amino-1,9-dihydro-9-b-D-ribofuranosyl-6H-purin-6-one | Generator | | 2-Amino-1,9-dihydro-9-β-D-ribofuranosyl-6H-purin-6-one | Generator | | 2-Amino-9-b-D-ribofuranosyl-1,9-dihydro-6H-purin-6-one | Generator | | 2-Amino-9-β-D-ribofuranosyl-1,9-dihydro-6H-purin-6-one | Generator | | 9-b-D-Ribofuranosyl-guanine | Generator | | 9-Β-D-ribofuranosyl-guanine | Generator | | Guanine-9-b-D-ribofuranoside | Generator | | Guanine-9-β-D-ribofuranoside | Generator | | 2-Amino-1,9-dihydro-9-beta-delta-ribofuranosyl-6H-purin-6-one | HMDB | | 2-Amino-inosine | HMDB | | 9-beta-delta-Ribofuranosyl-guanine | HMDB | | b-D-Ribofuranoside guanine-9 | HMDB | | beta-delta-Ribofuranoside guanine-9 | HMDB | | Ribonucleoside | HMDB | | Vernine | HMDB |
|
|---|
| Chemical Formula | C10H13N5O5 |
|---|
| Average Molecular Weight | 283.2407 |
|---|
| Monoisotopic Molecular Weight | 283.091668551 |
|---|
| IUPAC Name | 2-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6,9-dihydro-1H-purin-6-one |
|---|
| Traditional Name | guanosine |
|---|
| CAS Registry Number | 118-00-3 |
|---|
| SMILES | NC1=NC2=C(N=CN2[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)C(=O)N1 |
|---|
| InChI Identifier | InChI=1S/C10H13N5O5/c11-10-13-7-4(8(19)14-10)12-2-15(7)9-6(18)5(17)3(1-16)20-9/h2-3,5-6,9,16-18H,1H2,(H3,11,13,14,19)/t3-,5-,6-,9-/m1/s1 |
|---|
| InChI Key | NYHBQMYGNKIUIF-UUOKFMHZSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | belongs to the class of organic compounds known as purine nucleosides. Purine nucleosides are compounds comprising a purine base attached to a ribosyl or deoxyribosyl moiety. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Nucleosides, nucleotides, and analogues |
|---|
| Class | Purine nucleosides |
|---|
| Sub Class | Not Available |
|---|
| Direct Parent | Purine nucleosides |
|---|
| Alternative Parents | |
|---|
| Substituents | - Purine nucleoside
- Glycosyl compound
- N-glycosyl compound
- Pentose monosaccharide
- Imidazopyrimidine
- Purine
- Hydroxypyrimidine
- Monosaccharide
- N-substituted imidazole
- Pyrimidine
- Heteroaromatic compound
- Azole
- Imidazole
- Tetrahydrofuran
- Secondary alcohol
- Azacycle
- Oxacycle
- Organoheterocyclic compound
- Primary alcohol
- Organopnictogen compound
- Organooxygen compound
- Organonitrogen compound
- Alcohol
- Hydrocarbon derivative
- Organic oxygen compound
- Organic nitrogen compound
- Aromatic heteropolycyclic compound
|
|---|
| Molecular Framework | Aromatic heteropolycyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Status | Detected and Quantified |
|---|
| Origin | |
|---|
| Biofunction | Not Available |
|---|
| Application | Not Available |
|---|
| Cellular locations | - Cytoplasm
- Lysosome
- Mitochondria
|
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Properties | | Property | Value | Reference |
|---|
| Melting Point | 239 °C | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | 0.7 mg/mL at 18 °C | Not Available | | LogP | -1.9 | SANGSTER (1993) |
|
|---|
| Predicted Properties | |
|---|
| Spectra |
|---|
| Spectra | |
|---|