| Record Information |
|---|
| Version | 1.0 |
|---|
| Creation Date | 2016-09-30 22:19:14 UTC |
|---|
| Update Date | 2020-05-21 16:28:47 UTC |
|---|
| BMDB ID | BMDB0000068 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Epinephrine |
|---|
| Description | Epinephrinee, also known as epinephrinee or epinephrine, belongs to the class of organic compounds known as catechols. Catechols are compounds containing a 1,2-benzenediol moiety. Epinephrinee exists as a solid, possibly soluble (in water), and a very strong basic compound (based on its pKa) molecule. Epinephrinee exists in all living organisms, ranging from bacteria to humans. Epinephrinee participates in a number of enzymatic reactions, within cattle. In particular, S-Adenosylhomocysteine and epinephrinee can be biosynthesized from S-adenosylmethionine and norepinephrinee through its interaction with the enzyme phenylethanolamine N-methyltransferase. In addition, Epinephrinee can be converted into 3,4-dihydroxymandelaldehyde and methylamine; which is catalyzed by the enzyme amine oxidase [flavin-containing] a. In cattle, epinephrinee is involved in the metabolic pathway called the tyrosine metabolism pathway. |
|---|
| Structure | |
|---|
| Synonyms | | Value | Source |
|---|
| (-)-(R)-Epinephrine | ChEBI | | (-)-3,4-Dihydroxy-alpha-((methylamino)methyl)benzyl alcohol | ChEBI | | (-)-Adrenaline | ChEBI | | (R)-(-)-Adrenaline | ChEBI | | (R)-(-)-Adnephrine | ChEBI | | (R)-(-)-Epinephrine | ChEBI | | (R)-(-)-Epirenamine | ChEBI | | 4-[(1R)-1-Hydroxy-2-(methylamino)ethyl]-1,2-benzenediol | ChEBI | | Adrenalin | ChEBI | | Adrenaline | ChEBI | | Epinefrina | ChEBI | | Epinephrin | ChEBI | | Epinephrinum | ChEBI | | Epipen | ChEBI | | Epipen JR | ChEBI | | L-Adrenaline | ChEBI | | Levoepinephrine | ChEBI | | Primatene | ChEBI | | Auvi-Q | Kegg | | (-)-3,4-Dihydroxy-a-((methylamino)methyl)benzyl alcohol | Generator | | (-)-3,4-Dihydroxy-α-((methylamino)methyl)benzyl alcohol | Generator | | (-)-3,4-Dihydroxy-a-[(methylamino)methyl]-benzyl alcohol | HMDB | | (-)-3,4-Dihydroxy-a-[2-(methylamino)ethyl]benzyl alcohol | HMDB | | (-)-3,4-Dihydroxy-alpha-[(methylamino)methyl]-benzyl alcohol | HMDB | | (-)-3,4-Dihydroxy-alpha-[2-(methylamino)ethyl]benzyl alcohol | HMDB | | (-)-Epinephrine | HMDB | | (R)-4-[1-Hydroxy-2-(methylamino)ethyl]-1,2-benzenediol | HMDB | | (R)-Adrenaline | HMDB | | (R)-Epinephrine | HMDB | | Adnephrine | HMDB | | Adrenal | HMDB | | Adrenine | HMDB | | Adrin | HMDB | | Ana-kit | HMDB | | Bosmin | HMDB | | Bronkaid mist | HMDB | | Chelafrin | HMDB | | Epifrin | HMDB | | Epiglaufrin | HMDB | | Epinephran | HMDB | | Epirenan | HMDB | | Eppy | HMDB | | Exadrin | HMDB | | Glauposine | HMDB | | Hemisine | HMDB | | Hemostasin | HMDB | | Hemostatin | HMDB | | Hypernephrin | HMDB | | Isoptoepinal | HMDB | | L-1-(3,4-Dihydroxyphenyl)-2-methylaminoethanol | HMDB | | L-Epinephrine | HMDB | | L-Epirenamine | HMDB | | L-Methylaminoethanolcatechol | HMDB | | Levorenen | HMDB | | Levorenin | HMDB | | Levorenine | HMDB | | Levoreninum | HMDB | | Lyodrin | HMDB | | Methylarterenol | HMDB | | Mucidrina | HMDB | | Nephridine | HMDB | | Nieraline | HMDB | | Paranephrin | HMDB | | Primatene mist | HMDB | | R-(-)-Epinephrine | HMDB | | Renaglandin | HMDB | | Renaleptine | HMDB | | Renalina | HMDB | | Renoform | HMDB | | Renostypticin | HMDB | | Renostyptin | HMDB | | Scurenaline | HMDB | | Simplene | HMDB | | Styptirenal | HMDB | | Supracapsulin | HMDB | | Supranephrane | HMDB | | Suprarenaline | HMDB | | Suprarenin | HMDB | | Surrenine | HMDB | | Sus-phrine | HMDB | | Takamina | HMDB | | Vasoconstrictine | HMDB | | Vasotonin | HMDB | | 4-(1-Hydroxy-2-(methylamino)ethyl)-1,2-benzenediol | HMDB | | Epinephrine bitartrate | HMDB | | Epinephrine hydrogen tartrate | HMDB | | Lyophrin | HMDB | | Adrenaline bitartrate | HMDB | | Adrenaline hydrochloride | HMDB | | Epinephrine acetate | HMDB | | Allergan brand OF adrenaline hydrochloride | HMDB | | Epitrate | HMDB | | Acetate, epinephrine | HMDB | | Adrenaline acid tartrate | HMDB | | Epinephrine hydrochloride | HMDB | | Medihaler-epi | HMDB |
|
|---|
| Chemical Formula | C9H13NO3 |
|---|
| Average Molecular Weight | 183.2044 |
|---|
| Monoisotopic Molecular Weight | 183.089543287 |
|---|
| IUPAC Name | 4-[(1R)-1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol |
|---|
| Traditional Name | epinephrine |
|---|
| CAS Registry Number | 51-43-4 |
|---|
| SMILES | CNC[C@H](O)C1=CC(O)=C(O)C=C1 |
|---|
| InChI Identifier | InChI=1S/C9H13NO3/c1-10-5-9(13)6-2-3-7(11)8(12)4-6/h2-4,9-13H,5H2,1H3/t9-/m0/s1 |
|---|
| InChI Key | UCTWMZQNUQWSLP-VIFPVBQESA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | belongs to the class of organic compounds known as catechols. Catechols are compounds containing a 1,2-benzenediol moiety. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Benzenoids |
|---|
| Class | Phenols |
|---|
| Sub Class | Benzenediols |
|---|
| Direct Parent | Catechols |
|---|
| Alternative Parents | |
|---|
| Substituents | - Catechol
- 1-hydroxy-4-unsubstituted benzenoid
- 1-hydroxy-2-unsubstituted benzenoid
- Aralkylamine
- Monocyclic benzene moiety
- 1,2-aminoalcohol
- Secondary alcohol
- Secondary amine
- Secondary aliphatic amine
- Aromatic alcohol
- Alcohol
- Organooxygen compound
- Organonitrogen compound
- Organic oxygen compound
- Organic nitrogen compound
- Amine
- Organopnictogen compound
- Hydrocarbon derivative
- Aromatic homomonocyclic compound
|
|---|
| Molecular Framework | Aromatic homomonocyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Status | Detected but not Quantified |
|---|
| Origin | |
|---|
| Biofunction | Not Available |
|---|
| Application | Not Available |
|---|
| Cellular locations | |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Properties | | Property | Value | Reference |
|---|
| Melting Point | 211.5 °C | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | 0.18 mg/mL | Not Available | | LogP | -1.37 | HANSCH,C & LEO,AJ (1985) |
|
|---|
| Predicted Properties | |
|---|
| Spectra |
|---|
| Spectra | |
|---|